Deoxyadenosine diphosphate

{{short description|Chemical compound}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447288226

| ImageFile=Desoxyadenosindiphosphat protoniert.svg

| ImageSize=220

| ImageAlt = Skeletal formula of adenosine diphosphate

| ImageFile1 = Deoxyadenosine-diphosphate-anion-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of the adenosine diphosphate anion

| IUPACName=2′-Deoxyadenosine 5′-(trihydrogen diphosphate)

| SystematicName=[(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl trihydrogen diphosphate

| OtherNames=dADP

| Reference=[https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=620 dADP - Compound Summary], PubChem.

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=2793-06-8

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = APQ916I0QD

| MeSHName=Deoxyadenosine+diphosphate

| PubChem = 188966

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 164196

| SMILES = C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O

| InChI = 1/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

| InChIKey = DAEAPNUQQAICNR-RRKCRQDMBL

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DAEAPNUQQAICNR-RRKCRQDMSA-N

}}

|Section2={{Chembox Properties

| Formula=C₁₀H₁₅N₅O₉P₂

| MolarMass=411.201722

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxyadenosine diphosphate is a nucleoside diphosphate. It is related to the common nucleic acid ATP, or adenosine triphosphate, with the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than ATP. This makes it also similar to adenosine diphosphate except with a hydroxyl group removed.

Deoxyadenosine diphosphate is abbreviated dADP.