Deoxyadenosine monophosphate

{{Chembox

| verifiedrevid = 447288275

| ImageFile= Desoxyadenosinmonophosphat protoniert.svg

| ImageAlt = Skeletal formula of deoxyadenosine monophosphate

| ImageFile1 = Deoxyadenosine-monophosphate-anion-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of the deoxyadenosine monophosphate anion

| IUPACName=2′-Deoxyadenylic acid

| SystematicName=[(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate

| OtherNames=

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 5120

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 12079

| InChI = 1/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

| InChIKey = KHWCHTKSEGGWEX-RRKCRQDMBS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KHWCHTKSEGGWEX-RRKCRQDMSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=653-63-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VFR8I97ORM

| PubChem=621

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 17713

| SMILES = c1nc(c2c(n1)n(cn2)[C@H]3C[C@@H]([C@H](O3)COP(=O)(O)O)O)N

| MeSHName=Deoxyadenosine+monophosphate

}}

|Section2={{Chembox Properties

| Formula=C₁₀H₁₄N₅O₆P

| MolarMass=331.222 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxyadenosine monophosphate (dAMP), also known as deoxyadenylic acid or deoxyadenylate in its conjugate acid and conjugate base forms, respectively, is a derivative of the common nucleotide adenosine monophosphate (AMP), in which the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose has been reduced to just a hydrogen atom (hence the "deoxy-" part of the name). Deoxyadenosine monophosphate is abbreviated dAMP. It is a monomer used in DNA.