Deoxycytidine diphosphate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447288252

| ImageFile = Desoxycytidindiphosphat protoniert.svg

| ImageAlt = Skeletal formula of deoxycytidine diphosphate as an anion (3- charge)

| ImageFile1 = Deoxycytidine diphosphate anion 3D spacefill.png

| ImageSize1 = 210

| ImageAlt1 = Space-filling model of the deoxycytidine diphosphate molecule as an anion (3- charge)

| IUPACName=2′-Deoxycytidine 5′-(trihydrogen diphosphate)

| SystematicName=[(2R,3S,5R)-5-(4-Amino-2-oxopyrimidin-1(2H)-yl)-3-hydroxyoxolan-2-yl]methyl trihydrogen diphosphate

| OtherNames=2'-Deoxycytidine diphosphate

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=800-73-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = M07S1BKN37

| PubChem=150855

| MeSHName=deoxycytidine+diphosphate

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 132961

| SMILES = O=P(O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N/1C(=O)/N=C(/N)\C=C\1)C[C@@H]2O

| InChI = 1/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1

| InChIKey = FTDHDKPUHBLBTL-SHYZEUOFBT

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = FTDHDKPUHBLBTL-SHYZEUOFSA-N

}}

|Section2={{Chembox Properties

| C=9 | H=15 | N=3 | O=10 | P=2

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxycytidine diphosphate is a nucleoside diphosphate. It is related to the common nucleic acid CTP, or cytidine triphosphate, with the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than CTP .

2'-Deoxycytidine diphosphate is abbreviated as dCDP.[https://www.nlm.nih.gov/cgi/mesh/2007/MB_cgi?mode=&index=108353 MeSH term], accessed Dec. 31, 2012