Deserpidine

{{Short description|Antihypertensive drug}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460777384

| ImageFile=File:Deserpidine.svg

| ImageFile2=File:Deserpidine 3D.png

| IUPACName=Methyl 17α-methoxy-18β-[(3,4,5-trimethoxybenzoyl)oxy]-3β,20α-yohimban-16β-carboxylate

| SystematicName=Methyl (1S,2R,4R,4aS,13bR,14aS)-2-methoxy-3-[(3,4,5-trimethoxybenzoyl)oxy]-1,2,3,4,4a,5,7,8,13,13b,14,14a-dodecahydroindolo[2′,3′:3,4]pyrido[1,2-b]isoquinoline-1-carboxylate

| OtherNames=

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 7064

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8232

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200515

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9016E3VB47

| InChI = 1/C32H38N2O8/c1-37-24-12-17(13-25(38-2)29(24)39-3)31(35)42-26-14-18-16-34-11-10-20-19-8-6-7-9-22(19)33-28(20)23(34)15-21(18)27(30(26)40-4)32(36)41-5/h6-9,12-13,18,21,23,26-27,30,33H,10-11,14-16H2,1-5H3/t18-,21+,23-,26-,27+,30+/m1/s1

| InChIKey = CVBMAZKKCSYWQR-WCGOZPBSBL

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C32H38N2O8/c1-37-24-12-17(13-25(38-2)29(24)39-3)31(35)42-26-14-18-16-34-11-10-20-19-8-6-7-9-22(19)33-28(20)23(34)15-21(18)27(30(26)40-4)32(36)41-5/h6-9,12-13,18,21,23,26-27,30,33H,10-11,14-16H2,1-5H3/t18-,21+,23-,26-,27+,30+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CVBMAZKKCSYWQR-WCGOZPBSSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=131-01-1

| PubChem=8550

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08194

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 27478

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01089

| SMILES = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2[nH]c1ccccc1c2CCN3C[C@H]4C[C@@H](OC(=O)c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC

}}

|Section2={{Chembox Properties

| C=32 | H=38 | N=2 | O=8

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = C02

| ATCCode_suffix = AA05

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deserpidine (INN) or reserpidine (USAN) is an antihypertensive drug structurally related to reserpine{{Cite journal

| last1 = Fulton | first1 = S. C.

| last2 = Healy | first2 = M. D.

| title = Comparison of the effectiveness of deserpidine, reserpine, and alpha-methyltyrosine on brain biogenic amines

| journal = Federation Proceedings

| volume = 35

| issue = 14

| pages = 2558–2562

| year = 1976

| pmid = 11134

}} differing only by the absence of a methoxy group on the indole ring. It is a naturally occurring alkaloid from Rauvolfia spp.