Desmethoxycurcumin

{{Chembox

| ImageFile = Demethoxycurcumin.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (1E,6E)-1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione

| OtherNames = Curcumin II; Desmethoxycurcumin; Monodemethoxycurcumin

|Section1={{Chembox Identifiers

| CASNo = 22608-11-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W2F8059T80

| PubChem = 5469424

| ChemSpiderID = 39463964

| SMILES = COc(c1)c(O)ccc(C=CC(=O)CC(=O)C=Cc(c2)ccc(O)c2)1

| InChI = InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+

| InChIKey = HJTVQHVGMGKONQ-LUZURFALSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=18 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Desmethoxycurcumin is a curcuminoid found in turmeric.{{Cite journal

| last1 = Sotanaphun | first1 = U.

| last2 = Phattanawasin | first2 = P.

| last3 = Sriphong | first3 = L.

| doi = 10.1002/pca.1086

| title = Application of Scion image software to the simultaneous determination of curcuminoids in turmeric (Curcuma longa)

| journal = Phytochemical Analysis

| volume = 20

| issue = 1

| pages = 19–23

| year = 2009

| pmid = 18683171

| pmc =

| bibcode = 2009PChAn..20...19S

}} Commercial grade curcumin contains a mixture of curcuminoids (desmethoxycurcumin 10–20%, bisdesmethoxycurcumin 5% or less).{{Citation |last=Wawer |first=I. |title=Chapter 4 - Solid-State Measurements of Drugs and Drug Formulations |date=2008-01-01 |url=https://www.sciencedirect.com/science/article/pii/B9780444531735000093 |work=NMR Spectroscopy in Pharmaceutical Analysis |pages=201–231 |editor-last=Holzgrabe |editor-first=Ulrike |place=Amsterdam |publisher=Elsevier |language=en |doi=10.1016/b978-0-444-53173-5.00009-3 |isbn=978-0-444-53173-5 |access-date=2022-07-03 |editor2-last=Wawer |editor2-first=Iwona |editor3-last=Diehl |editor3-first=Bernd|url-access=subscription }}