Desmethoxyfallypride
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name = Desmethoxyfallypride (18F)
| image = Desmethoxyfallypride 18F.svg
| width = 240
| alt = Chemical structure of Desmethoxyfallypride
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATC_prefix = none
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 166173-81-5
| CAS_supplemental =
| PubChem = 10404663
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 8580101
| UNII = CJD4EF9EME
| KEGG =
| ChEBI =
| ChEMBL = 428561
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = DMFP (18F)
| IUPAC_name =
| C=19 | H=27 | F=1 | N=2 | O=2
| SMILES = COC1=C(C=C(C=C1)CCCF)C(=O)NC[C@@H]2CCCN2CC=C
| StdInChI = 1S/C19H27FN2O2/c1-3-11-22-12-5-7-16(22)14-21-19(23)17-13-15(6-4-10-20)8-9-18(17)24-2/h3,8-9,13,16H,1,4-7,10-12,14H2,2H3,(H,21,23)/t16-/m0/s1
| StdInChIKey = VPBJNBUDASILSQ-INIZCTEOSA-N
}}
Desmethoxyfallypride is a moderate affinity dopamine D2 receptor/D3 receptor antagonist used in medical research, usually in the form of the radiopharmaceutical [F-18]-desmethoxyfallypride (DMFP(18F)){{cite journal | vauthors = Mukherjee J, Yang ZY, Brown T, Roemer J, Cooper M | title = 18F-desmethoxyfallypride: a fluorine-18 labeled radiotracer with properties similar to carbon-11 raclopride for PET imaging studies of dopamine D2 receptors | journal = Life Sciences | volume = 59 | issue = 8 | pages = 669–78 | year = 1996 | pmid = 8761017 | doi = 10.1016/0024-3205(96)00348-7 }}{{cite journal | title = (S)-N-((1-Allyl-2-pyrrolidinyl)methyl)-5-(3-[18F]fluoropropyl)-2-methoxybenzamide | year = 2004 | pmid = 20641474 | last1 = Leung | first1 = K. | journal = Molecular Imaging and Contrast Agent Database }} which has been used in human studies as a positron emission tomography (PET) radiotracer.{{cite journal | vauthors = Gründer G, Siessmeier T, Piel M, Vernaleken I, Buchholz HG, Zhou Y, Hiemke C, Wong DF, Rösch F, Bartenstein P | display-authors = 6 | title = Quantification of D2-like dopamine receptors in the human brain with 18F-desmethoxyfallypride | journal = Journal of Nuclear Medicine | volume = 44 | issue = 1 | pages = 109–16 | date = January 2003 | pmid = 12515884 }}{{cite journal | vauthors = Siessmeier T, Zhou Y, Buchholz HG, Landvogt C, Vernaleken I, Piel M, Schirrmacher R, Rösch F, Schreckenberger M, Wong DF, Cumming P, Gründer G, Bartenstein P | display-authors = 6 | title = Parametric mapping of binding in human brain of D2 receptor ligands of different affinities | journal = Journal of Nuclear Medicine | volume = 46 | issue = 6 | pages = 964–72 | date = June 2005 | pmid = 15937307 }}