Desmethoxyfallypride

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name = Desmethoxyfallypride (¹⁸F)

| image = Desmethoxyfallypride 18F.svg

| width = 240

| alt = Chemical structure of Desmethoxyfallypride

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix = none

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 166173-81-5

| CAS_supplemental =

| PubChem = 10404663

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 8580101

| UNII = CJD4EF9EME

| KEGG =

| ChEBI =

| ChEMBL = 428561

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = DMFP (18F)

| IUPAC_name = 5-(3-fluoropropyl)-2-methoxy-N-[[(2S)-1-prop-2-enylpyrrolidin-2-yl]methyl]benzamide

| C=19 | H=27 | F=1 | N=2 | O=2

| SMILES = COC1=C(C=C(C=C1)CCCF)C(=O)NC[C@@H]2CCCN2CC=C

| StdInChI = 1S/C19H27FN2O2/c1-3-11-22-12-5-7-16(22)14-21-19(23)17-13-15(6-4-10-20)8-9-18(17)24-2/h3,8-9,13,16H,1,4-7,10-12,14H2,2H3,(H,21,23)/t16-/m0/s1

| StdInChIKey = VPBJNBUDASILSQ-INIZCTEOSA-N

}}

Desmethoxyfallypride is a moderate affinity dopamine D₂ receptor/D₃ receptor antagonist used in medical research, usually in the form of the radiopharmaceutical [F-18]-desmethoxyfallypride (DMFP(¹⁸F)){{cite journal | vauthors = Mukherjee J, Yang ZY, Brown T, Roemer J, Cooper M | title = 18F-desmethoxyfallypride: a fluorine-18 labeled radiotracer with properties similar to carbon-11 raclopride for PET imaging studies of dopamine D2 receptors | journal = Life Sciences | volume = 59 | issue = 8 | pages = 669–78 | year = 1996 | pmid = 8761017 | doi = 10.1016/0024-3205(96)00348-7 }}{{cite journal | title = (S)-N-((1-Allyl-2-pyrrolidinyl)methyl)-5-(3-[¹⁸F]fluoropropyl)-2-methoxybenzamide | year = 2004 | pmid = 20641474 | last1 = Leung | first1 = K. | journal = Molecular Imaging and Contrast Agent Database }} which has been used in human studies as a positron emission tomography (PET) radiotracer.{{cite journal | vauthors = Gründer G, Siessmeier T, Piel M, Vernaleken I, Buchholz HG, Zhou Y, Hiemke C, Wong DF, Rösch F, Bartenstein P | display-authors = 6 | title = Quantification of D2-like dopamine receptors in the human brain with 18F-desmethoxyfallypride | journal = Journal of Nuclear Medicine | volume = 44 | issue = 1 | pages = 109–16 | date = January 2003 | pmid = 12515884 }}{{cite journal | vauthors = Siessmeier T, Zhou Y, Buchholz HG, Landvogt C, Vernaleken I, Piel M, Schirrmacher R, Rösch F, Schreckenberger M, Wong DF, Cumming P, Gründer G, Bartenstein P | display-authors = 6 | title = Parametric mapping of binding in human brain of D2 receptor ligands of different affinities | journal = Journal of Nuclear Medicine | volume = 46 | issue = 6 | pages = 964–72 | date = June 2005 | pmid = 15937307 }}