Desmethylcitalopram

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451226128

| IUPAC_name = (RS/S)-1-[3-(Methylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile

| image = Desmethylcitalopram.svg

| image_class = skin-invert-image

| alt = Skeletal formula of desmethylcitalopram /

| width = 200px

| image2 = Desmethylcitalopram molecule spacefill.png

| alt2 = Space-filling model of the desmethylcitalopram molecule

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 50 h

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 62498-67-3

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 3KBX9104IR

| ATC_prefix = none

| ATC_suffix =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| PubChem = 162180

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 142424

| C=19 | H=19 | F=1 | N=2 | O=1

| smiles = CNCCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H19FN2O/c1-22-10-2-9-19(16-4-6-17(20)7-5-16)18-8-3-14(12-21)11-15(18)13-23-19/h3-8,11,22H,2,9-10,13H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PTJADDMMFYXMMG-UHFFFAOYSA-N

}}

Desmethylcitalopram is an active metabolite of the antidepressant drugs citalopram (racemic) and escitalopram (the S-enantiomer, which would be called desmethylescitalopram).{{cite web | url = http://www.hmdb.ca/metabolites/HMDB0014021 | title = Desmethylcitalopram | work = Human Metabolome Database}}{{cite journal | vauthors = Brøsen K, Naranjo CA | title = Review of pharmacokinetic and pharmacodynamic interaction studies with citalopram | journal = European Neuropsychopharmacology | volume = 11 | issue = 4 | pages = 275–83 | date = August 2001 | pmid = 11532381 | doi = 10.1016/s0924-977x(01)00101-8 | s2cid = 11837037 }} Like citalopram and escitalopram, desmethylcitalopram functions as a selective serotonin reuptake inhibitor (SSRI), and is responsible for some of its patient's therapeutic benefits.