Desoxycorticosterone acetate

{{Short description|Steroid medication}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate

| image = Desoxycorticosterone acetate.svg

| width =

| tradename = Percorten Acetate, Decosterone, others

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| class = Corticosteroid; Mineralocorticoid

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 56-47-3

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 5952

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB06780

| ChemSpiderID_Ref =

| ChemSpiderID = 5737

| UNII = 6E0A168OB8

| KEGG = D03698

| ChEBI = 34671

| ChEMBL = 1200542

| synonyms = DOCA; 11-Deoxycorticosterone 21-acetate; 21-Acetoxypregn-4-ene-3,20-dione

| C=23 | H=32 | O=4

| SMILES = CC(=O)OCC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C

| StdInChI_Ref =

| StdInChI = 1S/C23H32O4/c1-14(24)27-13-21(26)20-7-6-18-17-5-4-15-12-16(25)8-10-22(15,2)19(17)9-11-23(18,20)3/h12,17-20H,4-11,13H2,1-3H3/t17-,18-,19-,20+,22-,23-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = VPGRYOFKCNULNK-ACXQXYJUSA-N

}}

Desoxycorticosterone acetate (also known as DOCA and 11-deoxycorticosterone 21-acetate and sold under the brand names Percorten Acetate and Decosterone, among others) is a mineralocorticoid medication and a mineralocorticoid ester.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA665|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=665–}}{{cite book|author=Swiss Pharmaceutical Society|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA306|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=306–307}} It is formulated as an oil solution and is administered once daily by intramuscular injection.{{cite journal | vauthors = Chien YW | title = Long-acting parenteral drug formulations | journal = J Parenter Sci Technol | volume = 35 | issue = 3 | pages = 106–39 | date = 1981 | pmid = 6113276 | doi = | url = https://journal.pda.org/content/35/3/106.short}} The medication is the C21 acetate ester of 11-deoxycorticosterone.