Desoxycorticosterone pivalate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate

| image = Desoxycorticosterone pivalate.svg

| width = 250px

| tradename = Zycortal, Percorten V, Percorten M, Neocortin Depositum, Neocortodina Depositum, Neodin Depositum

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| class = Corticosteroid; Mineralocorticoid

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 808-48-0

| CAS_supplemental =

| ATC_prefix = H02

| ATC_suffix = AA03

| ATC_supplemental =

| PubChem = 11876263

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB01134

| ChemSpiderID_Ref =

| ChemSpiderID = 10050591

| UNII = 16665T4A2X

| KEGG = D03699

| ChEBI = 50782

| ChEMBL = 1200592

| synonyms = DOCP; Deoxycorticosterone pivalate; Desoxycortone pivalate; Deoxycortone pivalate; Percoten pivalate; Desoxycorticosterone trimethylacetate; Desoxycorticosterone trimethyl acetate; DCT; DOC-TMA; SC-46312; 21-Hydroxypregn-4-ene-3,20-dione pivalate; 21-(2,2-Dimethyl-1-oxopropoxy)pregn-4-ene-3,20-dione

| C=26 | H=38 | O=4

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)COC(=O)C(C)(C)C)CCC4=CC(=O)CC[C@]34C

| StdInChI_Ref =

| StdInChI = 1S/C26H38O4/c1-24(2,3)23(29)30-15-22(28)21-9-8-19-18-7-6-16-14-17(27)10-12-25(16,4)20(18)11-13-26(19,21)5/h14,18-21H,6-13,15H2,1-5H3/t18-,19-,20-,21+,25-,26-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = VVOIQBFMTVCINR-WWMZEODYSA-N

}}

Deoxycorticosterone pivalate (DOCP), also known as desoxycorticosterone trimethyl acetate (DOC-TMA or DCT) and sold under the brand names Zycortal, Percorten V, and Percorten M, is a mineralocorticoid medication and a mineralocorticoid ester.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA665|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=665–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA307|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=307–}}{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA93|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=93–}}{{cite book| vauthors = Negwer M, Scharnow HG |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=1XBqAAAAMAAJ|date=4 October 2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5|page=2721|quote=[...] Deoxycortone trimethylacetate, Desoxycorticosterone pivalate. Neocortin depositum, Neocortodina depositum. Neodin-Depositum, Percorten M, Percorten pivalate U Mineralocorticoid (salt-regulating)}} It is formulated as a microcrystalline aqueous suspension, is administered by intramuscular injection at regular intervals, and has a prolonged duration of action.{{cite book| vauthors = Hager HH, Kern W, List PH, Roth HJ |title=Hagers Handbuch der Pharmazeutischen Praxis: Für Apotheker, Arzneimittelhersteller, Ärzte und Medizinalbeamte: Wirkstoffgruppen II Chemikalien und Drogen (A-AL)|url=https://books.google.com/books?id=a2a0BgAAQBAJ&pg=PA108|date=29 July 2013|publisher=Springer-Verlag|isbn=978-3-662-25655-8|pages=108–109}} The medication is the C21 pivalate (trimethylacetate) ester of 11-deoxycorticosterone.