Deudomperidone

{{Infobox drug

| drug_name =

| image = File:Deudomperidone skeletal.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2121525-08-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HN0VIB0W8W

| CAS_supplemental =

| PubChem = 153420471

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 58794254

| KEGG = D11864

| ChEBI =

| ChEMBL = 4594380

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = CIN-102; deuterated domperidone; domperidone deuterated

| IUPAC_name = 3-[3-[4-(5-chloro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]propyl]-4,5,6,7-tetradeuterio-1H-benzimidazol-2-one

| C=22 | H=20 | D=4 | Cl=1 | N=5 | O=2

| SMILES = [2H]C1=C(C(=C2C(=C1[2H])NC(=O)N2CCCN3CCC(CC3)N4C5=C(C=C(C=C5)Cl)NC4=O)[2H])[2H]

| StdInChI = 1S/C22H24ClN5O2/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30)/i1D,2D,4D,5D

| StdInChIKey = FGXWKSZFVQUSTL-GYABSUSNSA-N

}}

Deudomperidone (developmental code name CIN-102; also known as deuterated domperidone) is a dopamine antagonist medication which is under development in the United States for the treatment of gastroparesis.{{Cite web|url=https://adisinsight.springer.com/drugs/800050807|title=Deudomperidone - CinRx Pharma | work = AdisInsight | publisher = Springer Nature Switzerland AG }}{{cite journal | vauthors = Heckroth M, Luckett RT, Moser C, Parajuli D, Abell TL | title = Nausea and Vomiting in 2021: A Comprehensive Update | journal = Journal of Clinical Gastroenterology | volume = 55 | issue = 4 | pages = 279–299 | date = April 2021 | pmid = 33471485 | pmc = 7933092 | doi = 10.1097/MCG.0000000000001485 }}{{cite book | veditors = McCallum RW, Parkman HP | title = Gastroparesis | vauthors = Wo JM, McCallum RW, Gonzalez Z | chapter = Antiemetic therapy for gastroparesis | date = 2021 | pages = 341–359 | publisher = Elsevier | doi = 10.1016/B978-0-12-818586-5.00025-9 | isbn = 9780128185865| s2cid = 225132800| url = }} It acts as a selective dopamine D₂ and D₃ receptor antagonist and has peripheral selectivity. Deudomperidone is a deuterated form of domperidone, and it is suggested that deudomperidone may have improved efficacy, tolerability, and pharmacokinetics compared to domperidone. As of January 2022, deudomperidone is in phase 2 clinical trials for the treatment of gastroparesis.