Deuterated THF

{{short description|Chemical compound}}{{Chembox

| Watchedfields = changed

| verifiedrevid = 441909944

| ImageFile2 = Tetrahydrofuran-3D-balls.png

| ImageFile2_Ref = {{chemboximage|correct|??}}

| ImageSize2 = 121

| ImageName2 = Ball and stick model of deuterated THF

| ImageFileL1 = Gedeutereerd THF.png

| ImageFileL1_Ref = {{chemboximage|correct|??}}

| ImageNameL1 = Skeletal formula of deuterated THF

| ImageFileR1 = Tetrahydrofuran-3D-vdW.png

| ImageFileR1_Ref = {{chemboximage|correct|??}}

| ImageNameR1 = Spacefill model of deuterated THF

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 1693-74-9

| PubChem = 80290

| ChemSpiderID = 72531

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| EINECS = 216-898-4

| UNNumber = 2056

| Beilstein = 111854

| SMILES = [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H]

| StdInChI = 1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i1D2,2D2,3D2,4D2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WYURNTSHIVDZCO-SVYQBANQSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

|Section2={{Chembox Properties

| Formula ={{Chem|C|4|D|8|O}}

| MolarMass = 80.1550 g mol⁻¹

| Appearance = Colourless liquid

| Density = 985 mg cm⁻³

| MeltingPtC = -106

| BoilingPtC = 65 to 66

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS flame}} {{GHS exclamation mark}}

| GHSSignalWord = DANGER

| HPhrases = {{H-phrases|225|319|335}}

| PPhrases = {{P-phrases|210|261|305+351+338}}

| FlashPtC = −17

| NFPA-F = 3

| NFPA-H = 2

| NFPA-R = 0

}}

}}

Deuterated tetrahydrofuran (d₈-THF) is a colourless, organic liquid at standard temperature and pressure.{{Cite journal |last1=Andersson |first1=O. |last2=Suga |first2=H. |date=1996-01-01 |title=Thermal conductivity of normal and deuterated tetrahydrofuran clathrate hydrates |url=https://dx.doi.org/10.1016/0022-3697%2895%2900157-3 |journal=Journal of Physics and Chemistry of Solids |language=en |volume=57 |issue=1 |pages=125–132 |doi=10.1016/0022-3697(95)00157-3 |issn=0022-3697|url-access=subscription }} This heterocyclic compound has the chemical formula C₄D₈O, and is an isotopologue of tetrahydrofuran.{{Cite journal |last1=David |first1=W. I. F. |last2=Ibberson |first2=R. M. |date=1992-02-15 |title=A reinvestigation of the structure of tetrahydrofuran by high-resolution neutron powder diffraction |url=http://scripts.iucr.org/cgi-bin/paper?S0108270191008582 |journal=Acta Crystallographica Section C: Crystal Structure Communications |language=en |volume=48 |issue=2 |pages=301–303 |doi=10.1107/S0108270191008582 |issn=0108-2701|url-access=subscription }} Deuterated THF is used as a solvent in NMR spectroscopy, though its expense can often be prohibitive.{{Citation needed|date = July 2011}}