Devazepide

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405810511

| IUPAC_name = N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1H-indole-2-carboxamide

| image = Devazepide.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 103420-77-5

| ATC_prefix = none

| ATC_suffix =

| IUPHAR_ligand = 878

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = JE6P7QY7NH

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02693

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 9506

| PubChem = 443375

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 391607

| smiles = O=C(c2cc1ccccc1[nH]2)N[C@H]3/N=C(\c4ccccc4N(C3=O)C)c5ccccc5

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H20N4O2/c1-29-21-14-8-6-12-18(21)22(16-9-3-2-4-10-16)27-23(25(29)31)28-24(30)20-15-17-11-5-7-13-19(17)26-20/h2-15,23,26H,1H3,(H,28,30)/t23-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NFHRQQKPEBFUJK-HSZRJFAPSA-N

| C=25 | H=20 | N=4 | O=2

}}

Devazepide{{cite patent | country = US | number = 4820834 |title=Benzodiazepine analogs|pubdate=1989-04-11|assign=Merck & Co. Inc.|inventor1-last=Evans|inventor1-first=Ben E.|inventor2-last=Freidinger|inventor2-first=Roger M.|inventor3-last=Bock|inventor3-first=Mark G.}} (L-364,718, MK-329) is benzodiazepine drug, but with quite different actions from most benzodiazepines, lacking affinity for GABAA receptors and instead acting as an CCKA receptor antagonist.{{cite journal | vauthors = Hill DR, Woodruff GN | title = Differentiation of central cholecystokinin receptor binding sites using the non-peptide antagonists MK-329 and L-365,260 | journal = Brain Research | volume = 526 | issue = 2 | pages = 276–83 | date = September 1990 | pmid = 2257485 | doi = 10.1016/0006-8993(90)91232-6 | s2cid = 23851131 }} It increases appetite and accelerates gastric emptying,{{cite journal | vauthors = Cooper SJ, Dourish CT | title = Multiple cholecystokinin (CCK) receptors and CCK-monoamine interactions are instrumental in the control of feeding | journal = Physiology & Behavior | volume = 48 | issue = 6 | pages = 849–57 | date = December 1990 | pmid = 1982361 | doi = 10.1016/0031-9384(90)90239-z | s2cid = 24850080 }}{{cite journal | vauthors = Cooper SJ, Dourish CT, Clifton PG | title = CCK antagonists and CCK-monoamine interactions in the control of satiety | journal = The American Journal of Clinical Nutrition | volume = 55 | issue = 1 Suppl | pages = 291S–295S | date = January 1992 | pmid = 1728842 | doi = 10.1093/ajcn/55.1.291s | doi-access = free }} and has been suggested as a potential treatment for a variety of gastrointestinal problems including dyspepsia, gastroparesis and gastric reflux.{{cite journal | vauthors = Scarpignato C, Varga G, Corradi C | title = Effect of CCK and its antagonists on gastric emptying | journal = Journal of Physiology, Paris | volume = 87 | issue = 5 | pages = 291–300 | year = 1993 | pmid = 8298606 | doi = 10.1016/0928-4257(93)90035-r | s2cid = 23725376 }} It is also widely used in scientific research into the CCKA receptor.{{cite journal | vauthors = Weller A | title = The ontogeny of postingestive inhibitory stimuli: examining the role of CCK | journal = Developmental Psychobiology | volume = 48 | issue = 5 | pages = 368–79 | date = July 2006 | pmid = 16770766 | doi = 10.1002/dev.20148 }}{{cite journal | vauthors = Savastano DM, Covasa M | title = Intestinal nutrients elicit satiation through concomitant activation of CCK(1) and 5-HT(3) receptors | journal = Physiology & Behavior | volume = 92 | issue = 3 | pages = 434–42 | date = October 2007 | pmid = 17531277 | doi = 10.1016/j.physbeh.2007.04.017 | s2cid = 5566756 }}

Synthesis

Devazepide is synthesised in a similar manner to other benzodiazepines.{{cite journal | vauthors = Evans BE, Rittle KE, Bock MG, DiPardo RM, Freidinger RM, Whitter WL, Lundell GF, Veber DF, Anderson PS, Chang RS | display-authors = 6 | title = Methods for drug discovery: development of potent, selective, orally effective cholecystokinin antagonists | journal = Journal of Medicinal Chemistry | volume = 31 | issue = 12 | pages = 2235–46 | date = December 1988 | pmid = 2848124 | doi = 10.1021/jm00120a002 }}{{cite patent|country=EP|number=1492540|title=The use of devazepide as analgesic agent|pubdate=2005-01-05|assign=ML Laboratories plc|inventor1-last=Jackson|inventor1-first=Karen}}

See also

References