Di(propylene glycol) methyl ether

{{Chembox

| ImageFile = Dipropylenglycolmethylether_Structural_Formulae_V1.svg

| ImageSize = 250px

| ImageCaption =

| IUPACName =

| OtherNames = Dipropylene glycol monomethyl ether; Dipropyleneglycol methyl ether; DPGME; DPM;{{Cite web | url = https://www.shell.com/business-customers/chemicals/our-products/solvents-chemical/glycol-ethers/ethyl-proxitol/_jcr_content/par/tabbedcontent/tab/textimage.stream/1447834752983/da79a786d90a46916a0ea2362c0fe60b6e1ebc2d/proxitol-glycol-ethersbrochuredec2011.pdf | title = Shell Chemicals | publisher = Shell}} (2-methoxymethylethoxy)propanol

| Section1 = {{Chembox Identifiers

| CASNo = 34590-94-8

| CASNo_Comment = (mixture of isomers)

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RQ1X8FMQ9N

| UNII_Comment = (mixture of isomers)

| PubChem = 22833331

| ChEMBL = 3182921

| ChemSpiderID = 23783

| ChemSpiderID1 = 17215460

| EINECS = 252-104-2

| StdInChI=1S/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3

| StdInChIKey = SHRGCOIDGUJGJI-UHFFFAOYSA-N

| SMILES = CCC(O)OCCCOC

}}

| Section2 = {{Chembox Properties

| C=7|H=16|O=3

| Appearance =

| Density = 0.951 g/cm³

| MeltingPt =

| BoilingPtC = 190

| BoilingPt_ref =

| Solubility = Miscible

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPtC = 75

| FlashPt_ref =

| AutoignitionPt =

}}

}}

Di(propylene glycol) methyl ether is an organic solvent with a variety of industrial and commercial uses.[http://msdssearch.dow.com/PublishedLiteratureDOWCOM/dh_08ae/0901b803808ae5cc.pdf?filepath=oxysolvents/pdfs/noreg/110-00618.pdf&fromPage=GetDoc Technical Data Sheet]{{Cite web | url = http://nj.gov/health/eoh/rtkweb/documents/fs/0804.pdf | title = Hazardous Substance Fact Sheet | publisher = New Jersey Department of Health}} It finds use as a less volatile alternative to propylene glycol methyl ether and other glycol ethers. The commercial product is typically a mixture of four isomers.{{cite web | url = http://www.inchem.org/documents/sids/sids/34590-94-8.pdf | title = Dipropylene Glycol Methyl Ether | publisher = inchem.org}}