Dianin's compound

{{chembox

| verifiedrevid = 428777394

| ImageFile=Dianin.svg

| ImageSize=200px

| IUPACName=4-(2,2,4-Trimethyl-4-chromanyl)phenol

| OtherNames=4-p-Hydroxyphenyl-2,2,4-trimethylchroman

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 88264

| InChI = 1/C18H20O2/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17/h4-11,19H,12H2,1-3H3

| InChIKey = KXYDGGNWZUHESZ-UHFFFAOYAP

| SMILES1 = Oc1ccc(cc1)C2(c3c(OC(C2)(C)C)cccc3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H20O2/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17/h4-11,19H,12H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KXYDGGNWZUHESZ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=472-41-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 90766708Z6

| PubChem=97788

| SMILES=CC1(CC(C2=CC=CC=C2O1)(C)C3=CC=C(C=C3)O)C

}}

|Section2={{Chembox Properties

| Formula=C18H20O2

| MolarMass=268.35 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Dianin's compound (4-p-hydroxyphenyl-2,2,4-trimethylchroman) was first prepared by Aleksandr Dianin in 1914.{{cite journal|last = Dianin|first = A. P.|authorlink = Aleksandr Dianin|year = 1914|title = Condensation of phenol with unsaturated ketones. Condensation of phenol with mesityl oxide.|journal = Zhurnal Russkago Fiziko-Khimicheskago Obshchestva (J. Russ. Phys. Chem. Soc.)|language = Russian|volume = 36|pages = 1310–1319}} This compound is a condensation isomer of bisphenol A and acetone and of special importance in host–guest chemistry because it can form a large variety of clathrates with suitable guest molecules. One example is the clathrate of Dianin's compound with morpholine.{{cite journal|title = Enclathration of morpholinium cations by Dianin's compound: Salt formation by partial host-to-guest proton transfer|first1 = Gareth O.|last1 = Lloyd|first2 = Martin W.|last2 = Bredenkamp|first3 = Leonard J.|last3 = Barbour|journal = Chemical Communications|year = 2005|volume = 2005|issue = 32|pages = 4053–4055|doi = 10.1039/b507726e|pmid = 16091797}} Slow evaporation of a solution containing both organic compounds yields crystals. Each asymmetric unit cell making up the crystal contains six chroman molecules of which two are deprotonated and two protonated morpholine molecules. The six chroman molecules are racemate pairs.

References