Diazaborine B

{{Chembox

| ImageFile = Diazaborine B.svg

| ImageSize = 200px

| ImageAlt = Skeletal formula of diazaborine

| ImageFile1 = Diazaborine 3D spacefill.png

| ImageSize1 =

| ImageAlt1 = Space-filling model of the diazaborine molecule

| PIN = 2-(4-Methylbenzene-1-sulfonyl)-2,3,1-benzodiazaborinin-1(2H)-ol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 22959-81-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YEB3W2L5P3

| PubChem = 481709

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 83945

| ChEMBL = 168634

| ChemSpiderID = 422598

| DrugBank = DB08265

| SMILES = O=S(=O)(N2/N=C\c1c(cccc1)B2O)c3ccc(cc3)C

| InChI = InChI=1S/C14H13BN2O3S/c1-11-6-8-13(9-7-11)21(19,20)17-15(18)14-5-3-2-4-12(14)10-16-17/h2-10,18H,1H3

}}

|Section2={{Chembox Properties

| C=14 | H=13 | B=1 | N=2 | O=3 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Diazaborine B is a chemical compound that inhibits maturation of rRNAs for the large ribosomal subunit.{{cite journal | doi = 10.1128/MCB.24.14.6476-6487.2004 | title = Diazaborine Treatment of Yeast Cells Inhibits Maturation of the 60S Ribosomal Subunit | year = 2004 | last1 = Pertschy | first1 = B. | last2 = Zisser | first2 = G. | last3 = Schein | first3 = H. | last4 = Koffel | first4 = R. | last5 = Rauch | first5 = G. | last6 = Grillitsch | first6 = K. | last7 = Morgenstern | first7 = C. | last8 = Durchschlag | first8 = M. | last9 = Hogenauer | first9 = G. | journal = Molecular and Cellular Biology | volume = 24 | issue = 14 | pages = 6476–6487 | pmid = 15226447 | pmc = 434233 }}