Dibenzylpiperazine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424828904

| ImageFile = DBZP.svg

| ImageSize =

| ImageFile2 = DBZP3d.png

| ImageSize2 =

| PIN = 1,4-Dibenzylpiperazine

| OtherNames = DBZP

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 1034-11-3

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 616774W5JF

| PubChem = 200601

| SMILES = C1CN(CCN1CC2=CC=CC=C2)CC3=CC=CC=C3

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 173653

| SMILES2 = c1ccc(cc1)CN2CCN(CC2)Cc3ccccc3

| InChI = 1/C18H22N2/c1-3-7-17(8-4-1)15-19-11-13-20(14-12-19)16-18-9-5-2-6-10-18/h1-10H,11-16H2

| InChIKey = YPUGLZQRXQQCSX-UHFFFAOYAP

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H22N2/c1-3-7-17(8-4-1)15-19-11-13-20(14-12-19)16-18-9-5-2-6-10-18/h1-10H,11-16H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YPUGLZQRXQQCSX-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=18|H=22|N=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Dibenzylpiperazine (DBZP) is a piperazine derivative often found as an impurity in the recreational stimulant drug benzylpiperazine (BZP).{{cite journal | vauthors = Davies S, Wood DM, Smith G, Button J, Ramsey J, Archer R, Holt DW, Dargan PI | display-authors = 6 | title = Purchasing 'legal highs' on the Internet--is there consistency in what you get? | journal = QJM | volume = 103 | issue = 7 | pages = 489–93 | date = July 2010 | pmid = 20413562 | doi = 10.1093/qjmed/hcq056 | doi-access = free }} Presence of DBZP is a marker for low quality or badly made BZP. It can be made as a reaction byproduct during BZP synthesis, either because the reaction has been run at too high a temperature, or because an excess of benzyl chloride has been used.