Dibromine trioxide

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid =

| Name = Dibromine trioxide

| ImageFile = Dibromine trioxide.png

| IUPACName = Dibromine trioxide

| OtherNames = Bromine trioxide
Bromine bromate

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 53809-75-9

| PubChem = 15779614

| ChemSpiderID_Ref =

| ChemSpiderID = 11564402

| SMILES = BrO[Br](=O)=O

| StdInChI=1S/Br2O3/c1-5-2(3)4

| StdInChIKey = XLGPPSYTBHJSNE-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| Formula = Br₂O₃

| MolarMass = 207.806 g/mol

| Appearance = orange needles

| Density =

| Solubility =

| MeltingPt = decomposes around −40°C

{{Citation

| last1 = Perry

| first1 = Dale L.

| last2 = Phillips

| first2 = Sidney L.

| year = 1995

| title = Handbook of Inorganic Compounds

| publisher = CRC Press

| isbn = 0-8493-8671-3

| pages = 255

| url = https://books.google.com/books?id=0fT4wfhF1AsC&q=%22Mercury(I)+bromide%22&pg=PA255

| access-date = 2015-08-25

}}

| BoilingPt =

}}

| Section3 = {{Chembox Structure

|Structure_ref=

|LattConst_a= 1186.6 pm

|LattConst_b=762.9 pm

|LattConst_c=869.3 pm

|LattConst_beta=106.4

|CrystalStruct=monoclinic

|SpaceGroup=P2₁/c

}}

| Section7 = {{Chembox Hazards

| NFPA-H =

| NFPA-F =

| NFPA-R =

| FlashPt =

}}

| Section8 = {{Chembox Related

| OtherAnions = Bromine dioxide
Bromine trifluoride
Bromine pentafluoride

| OtherCations = Oxygen difluoride
Dichlorine monoxide
Chlorine dioxide
Iodine dioxide

}}

}}

Dibromine trioxide is the chemical compound composed of bromine and oxygen with the formula Br₂O₃. It is an orange solid that is stable below −40 °C. It has the structure Br−O−BrO₂ (bromine bromate).{{cite book|last1=Henderson|first1=K. M. Mackay; R. A. Mackay; W.|title=Introduction to modern inorganic chemistry|date=2002|publisher=Nelson Thornes|location=Cheltenham|isbn=9780748764204|edition=6th}} It was discovered in 1993.{{cite journal | last=Kuschel | first=Raimund | last2=Seppelt | first2=Konrad | title=Brombromat Br₂O₃ | journal=Angewandte Chemie | publisher=Wiley | volume=105 | issue=11 | year=1993 | issn=0044-8249 | doi=10.1002/ange.19931051141 | pages=1734–1735}} The bond angle of Br−O−Br is 111.7°, the bond angle of O−Br=O is 103.1°, and the bond angle of O=Br=O is 107.6°. The Br−OBrO₂ bond length is 1.845 Å, the O−BrO₂ bond length is 1.855 Å and the Br=O bond length is 1.612 Å.{{cite journal | last=Jansen | first=Martin | last2=Kraft | first2=Thorsten | title=The Structural Chemistry of Binary Halogen Oxides in the Solid State | journal=Chemische Berichte | publisher=Wiley | volume=130 | issue=3 | year=1997 | issn=0009-2940 | doi=10.1002/cber.19971300302 | pages=307–316}}