Dichlofluanid
{{Chembox
| ImageFile = Dichlofluanid.svg
| ImageSize =
| IUPACName = N-{[Dichloro(fluoro)methyl]sulfanyl}-{{prime|N}},{{prime|N}}-dimethyl-N-phenylsulfuric diamide
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 1085-98-9
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 76A92XU36Y
| PubChem = 14145
| ChemSpiderID = 13520
| SMILES = CN(C)S(=O)(=O)N(C1=CC=CC=C1)SC(F)(Cl)Cl
| InChI = 1/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3
| InChIKey = WURGXGVFSMYFCG-UHFFFAOYAE
| StdInChI = 1S/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3
| StdInChIKey = WURGXGVFSMYFCG-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=9 | H=11 | Cl=2 | F=1 | N=2 | O=2 | S=2
| Appearance =
| Density = 1.55 g/cm3
| MeltingPtC = 105-106
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
}}
}}
Dichlofluanid (N-dichlorofluoromethylthio-{{prime|N}}, {{prime|N}}-dimethyl-N-phenylsulfamide) is a fungicide used to protect strawberries, grapes, berries, apples, pears and other fruit, vegetables and ornamental plants from diseases such as apple scab (Venturia inaequalis),{{cite book|editor1-last=Matolcsy|editor1-first=György|editor2-last=Nádasy|editor2-first=Miklós|editor3-last=Andriska|editor3-first=Viktor|title=Studies in Environmental Science: Volume 32 Pesticide chemistry|date=1988|publisher=Elsevier|location=Amsterdam|isbn=978-0-444-98903-1|pages=341|chapter=5. Fungicides}} black spot, leather rot, gray mold, downy mildew and others caused by the fungi Botrytis, Alternaria, Sclerotinia, and Monilinia. It is also used to protect against diseases of fruit during storage,{{citation needed|date=August 2017}} and as a wood preservative, often as part of a paint undercoat.{{cite book|last1=Unger|first1=A|last2=Schniewind|first2=AP|last3=Unger|first3=W|title=Conservation of Wood Artifacts: A Handbook|url=https://archive.org/details/conservationwood00unge|url-access=limited|date=2001|publisher=Springer Berlin Heidelberg|location=Berlin, Heidelberg|isbn=9783662063989|pages=[https://archive.org/details/conservationwood00unge/page/n117 217]–218|chapter=7.3.9.1.: Dichlofluanid (N-Dichlorofluoromethylthio-N'-N'-dimethyl-N-phenylsulfamide)}}
Dichlofluanid was first marketed by Bayer Company in 1964, for use as a fungicide on plants. Its trade names include Euparen and Elvaron.{{cite journal|last1=Zhou|first1=X|last2=Cao|first2=S|last3=Li|first3=X|last4=Xi|first4=C|last5=Ding|first5=X|last6=Xu|first6=F|last7=Hu|first7=J|last8=Chen|first8=Z|title=Rapid Determination of Dichlofluanid Residues in Vegetables Using Dispersive-SPE Sample Preparation Combined with Gas Chromatography-Mass Spectrometry|journal=Journal of Chromatographic Science|date=2016|volume=54|issue=5|pages=858–63|doi=10.1093/chromsci/bmw006|pmid=26921896|pmc=4890451}}
References
{{reflist}}
External links
- [http://gestis.itrust.de/nxt/gateway.dll/gestis_de/012130.xml?f=templates$fn=default.htm$3.0 Rocket NXT]
- {{cite journal | doi = 10.1016/j.chemosphere.2005.01.072| pmid = 16018903| title = Monitoring of the booster biocide dichlofluanid in water and marine sediment of Greek marinas| journal = Chemosphere| volume = 60| issue = 9| pages = 1316–1324| year = 2005| last1 = Hamwijk| first1 = C| last2 = Schouten| first2 = A| last3 = Foekema| first3 = E.M| last4 = Ravensberg| first4 = J.C| last5 = Collombon| first5 = M.T| last6 = Schmidt| first6 = K| last7 = Kugler| first7 = M| bibcode = 2005Chmsp..60.1316H}}
- [http://www.bibra-information.co.uk/profile-364.html Dichlofluanid toxicity reports, review - hazard potential, risk]
- {{Cite journal | doi = 10.1007/BF00467044| title = GC determination of dichlofluanid (Euparen) residues and its metabolite dimethylphenylsulfamide (DMSA) in strawberries| journal = Fresenius' Zeitschrift für Analytische Chemie| volume = 331| issue = 5| pages = 528–529| year = 1988| last1 = Waliszewski| first1 = S. M| last2 = Waliszewski| first2 = K. N| s2cid = 92516970}}
- [https://web.archive.org/web/20080919111226/http://circa.europa.eu/Public/irc/env/bio_reports/library?l=%2Fassessement_directive%2Fdichlofluanid_assessment%2F_EN_1.0_ Directive 98/8/EC concerning the placing of biocidal products on the market, Assessment Report Dichlofluanid]
- {{cite journal | doi = 10.1021/ja01464a052| title = Dichlorofluoromethanesulfenyl Chloride| journal = Journal of the American Chemical Society| volume = 83| issue = 3| pages = 751–752| year = 1961| last1 = Ham| first1 = Norman S}}
- T.R. Roberts, D.H. Hutson, Metabolic Pathways of agrochemicals. Part one: Herbicides and Plant Growth Regulators, Royal Society of Chemistry Publishers, London (1998)
{{agri-stub}}
{{Carbohydrate-stub}}