Dichlorine pentoxide

{{chembox

| ImageFile = Dichlorine pentoxide (peroxo).png

| IUPACName = Dichlorine pentoxide

| OtherNames =

| SystematicName = Chlorooxy perchlorate

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 264271-80-9

| CASNo_Comment = (trioxo[μ-(peroxy-κO:κO')]dichlorine)

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 224299-16-5

| index1_label = (perchloryl chloride peroxide)

| PubChem1 = 153991604

| PubChem2 = 154081050

| PubChem2_Comment = (chloryl chlorate)

| ChEBI_Ref =

| ChEBI =

| SMILES = O=ClOOCl(=O)=O

| InChI1=1S/Cl2O5/c1-6-7-2(3,4)5

| InChIKey1 = RHCPNFIPHZVCBF-UHFFFAOYSA-N

| SMILES1 = ClOOCl(=O)(=O)=O

| InChI2=1S/Cl2O5/c3-1(4)7-2(5)6

| InChIKey2 = LJQOTKFLOZZVML-UHFFFAOYSA-N

| SMILES2 = O=Cl(=O)OCl(=O)=O

}}

| Section2 = {{Chembox Properties

| Formula = |Cl=2|O=5

| MolarMass =

| Appearance =

| Density =

| MeltingPtC =

| BoilingPtC =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

| Section4 = {{Chembox Related

| OtherCompounds = Dichlorine heptoxide

}}

}}

Dichlorine pentoxide is a hypothetical chlorine oxide with a chemical formula Cl₂O₅. The most stable configuration of dichlorine pentoxide is unknown, but theory predicts that the perchloryl/chloride peroxide structure would be the most stable among various isomers,{{cite journal |doi=10.1021/jp993398y|title=Gaussian-2 and Gaussian-3 Study of the Energetics and Structures of Cl2Onand Cl2On+,n= 1−7|year=2000|last1=Li|first1=Wai-Kee|last2=Lau|first2=Kai-Chung|last3=Ng|first3=C. Y.|last4=Baumgärtel|first4=H.|last5=Weitzel|first5=K.-M.|journal=The Journal of Physical Chemistry A|volume=104|issue=14|pages=3197–3203|bibcode=2000JPCA..104.3197L}} such as the anhydride of chloric acid or the chlorous acid/perchloric acid mixed anhydride.