Dienestrol diacetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[(2Z,4E)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate

| image = Dienestrol diacetate.svg

| width = 250px

| tradename = Faragynol, Gynocyrol

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Nonsteroidal estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 24705-61-1

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 24884313

| DrugBank_Ref =

| DrugBank = DB14668

| ChemSpiderID_Ref =

| ChemSpiderID = 4707742

| ChEMBL = 3188355

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D20D148WPQ

| synonyms = Dienestrol acetate; Lipamone

| index2_label = ACI

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 84-19-5

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = D20D148WPQ

| C=22 | H=22 | N= | O=4

| SMILES = C\C=C(c1ccc(OC(C)=O)cc1)/C(=C/C)c2ccc(OC(C)=O)cc2

| StdInChI_Ref =

| StdInChI = 1S/C22H22O4/c1-5-21(17-7-11-19(12-8-17)25-15(3)23)22(6-2)18-9-13-20(14-10-18)26-16(4)24/h5-14H,1-4H3/b21-5-,22-6+

| StdInChIKey_Ref =

| StdInChIKey = YWLLGDVBTLPARJ-LWKKFVLGSA-N

}}

Dienestrol diacetate (brand names Faragynol, Gynocyrol, others) is a synthetic nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA129|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=390}} It is an ester of dienestrol.

{{Oral potencies of estrogens}}

{{Parenteral potencies and durations of nonsteroidal estrogens}}

{{clear}}