Diethylstilbestrol dipropionate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[(E)-4-(4-propanoyloxyphenyl)hex-3-en-3-yl]phenyl] propanoate

| image = Diethylstilbestrol dipropionate.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| class = Nonsteroidal estrogen; Estrogen ester

| synonyms = DESDP; Diethylstilbestrol dipropanoate; Stilboestrol dipropionate; Stilbestrol dipropionate

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 130-80-3

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 657220

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 571380

| UNII = Y98CK3J0OL

| C=24 | H=28 | O=4

| SMILES = CCC(=O)Oc1ccc(cc1)\C(CC)=C(/CC)c2ccc(OC(=O)CC)cc2

| StdInChI_Ref =

| StdInChI = 1S/C24H28O4/c1-5-21(17-9-13-19(14-10-17)27-23(25)7-3)22(6-2)18-11-15-20(16-12-18)28-24(26)8-4/h9-16H,5-8H2,1-4H3/b22-21+

| StdInChIKey_Ref =

| StdInChIKey = VZMLEMYJUIIHNF-QURGRASLSA-N

}}

Diethylstilbestrol dipropionate (DESDP) (brand names Agostilben, Biokeral, Clinestrol, Cyclen, Estilbin, Estril, Neobenzoestrol, Orestol, Oroestrol, Ostregenin, Prostilbene, Stilbestriol DP, Stilboestrolum Dipropionicum, Stilboestrol, Synestrin, Willestrol, others), or diethylstilbestrol dipropanoate, also known as stilboestrol dipropionate ({{abbrlink|BANM|British Approved Name}}), is a synthetic nonsteroidal estrogen of the stilbestrol group that was formerly marketed widely throughout Europe.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA129|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=397}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA332|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=332–}} It is an ester of diethylstilbestrol with propionic acid, and is more slowly absorbed in the body than diethylstilbestrol.{{cite book | vauthors = Wilson CO, Gisvold O |title=Organic Chemistry in Pharmacy|url=https://books.google.com/books?id=08_QAAAAMAAJ|year=1949|publisher=J. B. Lippincott|page=168}} The medication has been said to be one of the most potent estrogens known.{{cite book | vauthors = Dallenbach-Hellweg G | chapter = Iatrogenic Changes of the Endometrium |title=Histopathology of the Endometrium | chapter-url = https://books.google.com/books?id=WaS1BwAAQBAJ&pg=PA200 |date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-3-642-96249-3|pages=200–}}

The medication has been available in both oral and intramuscular formulations.{{cite book| vauthors = Kahr H |title=Konservative Therapie der Frauenkrankheiten: Anzeigen, Grenzen und Methoden Einschliesslich der Rezeptur|url=https://books.google.com/books?id=Hte1BgAAQBAJ&pg=PA19|date=8 March 2013|publisher=Springer-Verlag|isbn=978-3-7091-5694-0|pages=19–20}}

{{Oral potencies of estrogens}}

{{Parenteral potencies and durations of nonsteroidal estrogens|align=left}}