Dieticyclidine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424837616
| IUPAC_name = N,N-diethyl-1-phenylcyclohexan-1-amine
| image = Dieticyclidine.svg
| width =
| tradename =
| pregnancy_category =
| legal_CA = Schedule I
| legal_UK = Class B
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 2201-19-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8JY6P22UVD
| ATC_prefix = none
| PubChem = 604690
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 525655
| smiles = CCN(CC)C1(CCCCC1)C2=CC=CC=C2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H25N/c1-3-17(4-2)16(13-9-6-10-14-16)15-11-7-5-8-12-15/h5,7-8,11-12H,3-4,6,9-10,13-14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GRHWLIMQOFAGHA-UHFFFAOYSA-N
| C=16 | H=25 | N=1
}}
Dieticyclidine (PCDE), or diethylphenylcyclohexylamine, is a psychoactive drug and research chemical of the arylcyclohexylamine chemical class related to phencyclidine (PCP) and eticyclidine (PCE). It acts as an NMDA receptor antagonist but has low potency and acts mainly as a prodrug for eticyclidine.{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Landaw EM, Chang AS, Ramamurthy S, Jenden DJ | title = A pharmacokinetic study of phenylcyclohexyldiethylamine. An analog of phencyclidine | journal = Drug Metabolism and Disposition | volume = 21 | issue = 1 | pages = 125–32 | year = 1993 | pmid = 8095205 }}{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Vargas HM, Landaw EM | title = A behavioral and pharmacokinetic study of the actions of phenylcyclohexyldiethylamine and its active metabolite, phenylcyclohexylethylamine | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 264 | issue = 3 | pages = 1401–5 | date = March 1993 | pmid = 8450474 }}
References
{{Reflist}}
{{General anesthetics}}
{{Depressants}}
{{Hallucinogens}}
{{Dopamine receptor modulators}}
{{Ionotropic glutamate receptor modulators}}
Category:Diethylamino compounds
Category:NMDA receptor antagonists
{{psychoactive-stub}}