Difluprednate

{{Short description|Corticosteroid drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405835759

| image = Difluprednate.svg

| image2 = Difluprednate 3D.png

| width2 = 150

| tradename = Durezol

| Drugs.com = {{drugs.com|monograph|difluprednate}}

| MedlinePlus = a609025

| licence_US = Difluprednate

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Durezol emulsion | website=DailyMed | date=11 July 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=d07b65d5-f8e3-4594-a7fb-108218746cec | access-date=7 March 2023}}

| legal_status =

| routes_of_administration = Eye drops

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 23674-86-4

| ATC_prefix = D07

| ATC_suffix = AC19

| ATC_supplemental = {{ATC|S01|BA16}}

| PubChem = 32037

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB06781

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 391990

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = S8A06QG2QE

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01266

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201749

| ChEBI_Ref =

| ChEBI = 31485

| IUPAC_name = [(6S,8S,9R,10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate

| C=27 | H=34 | F=2 | O=7

| SMILES = [H][C@@]12CC[C@](OC(=O)CCC)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@]12C

| StdInChI = 1S/C27H34F2O7/c1-5-6-23(34)36-26(22(33)14-35-15(2)30)10-8-17-18-12-20(28)19-11-16(31)7-9-24(19,3)27(18,29)21(32)13-25(17,26)4/h7,9,11,17-18,20-21,32H,5-6,8,10,12-14H2,1-4H3/t17-,18-,20-,21-,24-,25-,26-,27-/m0/s1

| StdInChIKey = WYQPLTPSGFELIB-JTQPXKBDSA-N

}}

Difluprednate, sold under the brand name Durezol, is a corticosteroid used for the treatment of post-operative ocular inflammation and pain.

It was approved for medical use in the United States in June 2008.{{cite web | title=Drug Approval Package: Durezol (Difluprednate) NDA #022212 | website=U.S. Food and Drug Administration (FDA) | date=25 July 2008 | url=https://www.accessdata.fda.gov/drugsatfda_docs/nda/2008/022212s000TOC.cfm | archive-url=https://web.archive.org/web/20120208005618/http://www.accessdata.fda.gov/drugsatfda_docs/nda/2008/022212s000TOC.cfm | url-status=dead | archive-date=February 8, 2012 | access-date=7 March 2023}}{{cite press release

| title = Sirion Therapeutics Announces FDA Approval of Durezol for Treatment of Postoperative Ocular Inflammation and Pain

| publisher = Sirion Therapeutics, Inc.

| date = 2008-06-24

| url = https://www.drugs.com/newdrugs/sirion-therapeutics-announces-fda-approval-durezol-postoperative-ocular-inflammation-pain-1031.html

| access-date = 2008-06-30

}} It is available as a generic medication.{{cite web | title=Competitive Generic Therapy Approvals | website=U.S. Food and Drug Administration (FDA) | date=29 June 2023 | url=https://www.fda.gov/drugs/generic-drugs/competitive-generic-therapy-approvals | access-date=29 June 2023 | archive-date=29 June 2023 | archive-url=https://web.archive.org/web/20230629233651/https://www.fda.gov/drugs/generic-drugs/competitive-generic-therapy-approvals | url-status=dead }}