Dinaphthylene dioxide
{{Chembox
| Reference = [https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=240798 Dinaphthylene dioxide], PubChem
| Name = Dinaphthylene dioxide
| ImageFile = Dinaphthylene dioxide.png
| ImageSize = 200px
| ImageName = Skeletal formula
| ImageFile1 = Dinaphthylene dioxide molecule ball.png
| ImageSize1 =
| ImageName1 = Ball-and-stick model
| PIN = Xantheno[2,1,9,8-klmna]xanthene
| OtherNames = Dinaphthalene dioxide
peri-Xanthenoxanthene
(2,8');(8,2')-dioxo-1,1'-binaphthyl
NSC47493
| Section1 = {{Chembox Identifiers
| CASNo = 191-28-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 72HE489YM9
| ChemSpiderID = 210417
| InChI = InChI=1/C20H10O2/c1-3-11-7-9-16-19-17(11)13(5-1)21-15-10-8-12-4-2-6-14(22-16)18(12)20(15)19/h1-10H
| InChIKey = AMDQVKPUZIXQFC-UHFFFAOYAZ
| PubChem = 240798
| SMILES = O2c1cccc5c1c4c3c2ccc6c3c(Oc4cc5)ccc6
}}
| Section2 = {{Chembox Properties
| C=20|H=10|O=2
}}
}}
Dinaphthylene dioxide, also known as peri-xanthenoxanthene (PXX), is an organic compound used to synthesize 3,9-diphenyl-peri-xanthenoxanthene (Ph-PXX). Ph-PXX, in its soluble form, is used as organic semiconductor for thin-film transistors (TFT).{{Cite journal | doi = 10.1021/cm802826m | title = Stableperi-Xanthenoxanthene Thin-Film Transistors with Efficient Carrier Injection | year = 2009 | last1 = Kobayashi | first1 = N. | last2 = Sasaki | first2 = M. | last3 = Nomoto | first3 = K. | journal = Chemistry of Materials | volume = 21 | issue = 3 | pages = 552–556}}
File:Br2PXX STM3.jpg images of brominated PXX molecules]]