Dinaphthylene dioxide

{{Chembox

| Reference = [https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=240798 Dinaphthylene dioxide], PubChem

| Name = Dinaphthylene dioxide

| ImageFile = Dinaphthylene dioxide.png

| ImageSize = 200px

| ImageName = Skeletal formula

| ImageFile1 = Dinaphthylene dioxide molecule ball.png

| ImageSize1 =

| ImageName1 = Ball-and-stick model

| PIN = Xantheno[2,1,9,8-klmna]xanthene

| OtherNames = Dinaphthalene dioxide
peri-Xanthenoxanthene
(2,8');(8,2')-dioxo-1,1'-binaphthyl
NSC47493

| Section1 = {{Chembox Identifiers

| CASNo = 191-28-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 72HE489YM9

| ChemSpiderID = 210417

| InChI = InChI=1/C20H10O2/c1-3-11-7-9-16-19-17(11)13(5-1)21-15-10-8-12-4-2-6-14(22-16)18(12)20(15)19/h1-10H

| InChIKey = AMDQVKPUZIXQFC-UHFFFAOYAZ

| PubChem = 240798

| SMILES = O2c1cccc5c1c4c3c2ccc6c3c(Oc4cc5)ccc6

}}

| Section2 = {{Chembox Properties

| C=20|H=10|O=2

}}

}}

Dinaphthylene dioxide, also known as peri-xanthenoxanthene (PXX), is an organic compound used to synthesize 3,9-diphenyl-peri-xanthenoxanthene (Ph-PXX). Ph-PXX, in its soluble form, is used as organic semiconductor for thin-film transistors (TFT).{{Cite journal | doi = 10.1021/cm802826m | title = Stableperi-Xanthenoxanthene Thin-Film Transistors with Efficient Carrier Injection | year = 2009 | last1 = Kobayashi | first1 = N. | last2 = Sasaki | first2 = M. | last3 = Nomoto | first3 = K. | journal = Chemistry of Materials | volume = 21 | issue = 3 | pages = 552–556}}

File:Br2PXX STM3.jpg images of brominated PXX molecules]]

References

{{reflist}}

Category:Polycyclic aromatic compounds

{{aromatic-compound-stub}}