Dinapsoline

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449577797

| IUPAC_name = 8,9-dihydroxy-2,3,7,11b-tetrahydro-1H-naph[1,2,3-de]isoquinoline

| image = Dinapsoline Structure.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 458563-40-1

| ATC_prefix = none

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GZ9XC6C5P9

| ATC_suffix =

| PubChem = 9816455

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 7992205

| C=16 | H=15 | N=1 | O=2

| smiles = Oc1c3c(ccc1O)[C@H]4c2c(cccc2C3)CNC4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H15NO2/c18-14-5-4-11-12(16(14)19)6-9-2-1-3-10-7-17-8-13(11)15(9)10/h1-5,13,17-19H,6-8H2/t13-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZQTSNGJHMUKLOM-ZDUSSCGKSA-N

}}

Dinapsoline is a drug developed for the treatment of Parkinson's disease,{{cite journal |vauthors=Gulwadi AG, Korpinen CD, Mailman RB, Nichols DE, Sit SY, Taber MT |title=Dinapsoline: characterization of a D1 dopamine receptor agonist in a rat model of Parkinson's disease |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=296 |issue=2 |pages=338–44 |date=February 2001 |pmid=11160615 }} that acts as a selective full agonist at the dopamine D₁ receptor.{{cite journal |vauthors=Ghosh D, Snyder SE, Watts VJ, Mailman RB, Nichols DE |title=9-Dihydroxy-2,3,7,11b-tetrahydro-1H-naph[1,2,3-de]isoquinoline: a potent full dopamine D1 agonist containing a rigid-beta-phenyldopamine pharmacophore |journal=Journal of Medicinal Chemistry |volume=39 |issue=2 |pages=549–55 |date=January 1996 |pmid=8558526 |doi= 10.1021/jm950707+}}{{cite journal |vauthors=Sit SY, Xie K, Jacutin-Porte S, Taber MT, Gulwadi AG, Korpinen CD, Burris KD, Molski TF, Ryan E, Xu C, Wong H, Zhu J, Krishnananthan S, Gao Q, Verdoorn T, Johnson G |title=(+)-Dinapsoline: an efficient synthesis and pharmacological profile of a novel dopamine agonist |journal=Journal of Medicinal Chemistry |volume=45 |issue=17 |pages=3660–8 |date=August 2002 |pmid=12166939 |doi= 10.1021/jm0101545}}{{cite journal |vauthors=Sit SY, Xie K, Jacutin-Porte S, Boy KM, Seanz J, Taber MT, Gulwadi AG, Korpinen CD, Burris KD, Molski TF, Ryan E, Xu C, Verdoorn T, Johnson G, Nichols DE, Mailman RB |title=Synthesis and SAR exploration of dinapsoline analogues |journal=Bioorg. Med. Chem. |volume=12 |issue=4 |pages=715–34 |date=February 2004 |pmid=14759732 |doi=10.1016/j.bmc.2003.11.015 }}{{cite journal |vauthors=Gleason SD, Witkin JM |title=Effects of dopamine D1 receptor agonists in rats trained to discriminate dihydrexidine |journal=Psychopharmacology |volume=186 |issue=1 |pages=25–31 |date=May 2006 |pmid=16575553 |doi=10.1007/s00213-006-0342-2 |s2cid=2159983 }}