Dinoterb
{{Distinguish|dinoseb}}
{{Chembox
| ImageFile = Dinoterb structure.svg
| ImageSize = 180px
| IUPACName = 2-tert-Butyl-4,6-dinitrophenol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 1420-07-1
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2O5H456CFI
| PubChem = 14994
| ChemSpiderID = 14274
| SMILES = [O-][N+](=O)c1cc(cc(c1O)C(C)(C)C)[N+]([O-])=O
| StdInChI = 1S/C10H12N2O5/c1-10(2,3)7-4-6(11(14)15)5-8(9(7)13)12(16)17/h4-5,13H,1-3H3
| StdInChIKey = IIPZYDQGBIWLBU-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=10 | H=12 | N=2 | O=5
| Appearance =
| Density = 1.35 g/cm3
| MeltingPtC = 125.5-126.5
| MeltingPt_ref = {{GESTIS|ZVG=510198}}
| BoilingPt =
| Solubility = 0.45 mg/L (20 °C)
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| LD50 = 26 mg/kg (rat, oral)
}}
}}
Dinoterb is a chemical compound previously used as a contact herbicide. It is an uncoupler, affecting respiration in mitochondria and photosynthesis in chloroplasts. It is banned for use in the European Union and use was suspended in the United States in 1986.{{cite web |title=Dinoterb |url=https://pubchem.ncbi.nlm.nih.gov/compound/Dinoterb |website=PubChem |publisher=National Library of Medicine |access-date=14 December 2023 |language=en}}
References
{{reflist}}