Disodium citrate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| ImageFile = Disodium citrate.png

| ImageSize = 220px

| verifiedrevid = 445304286

| IUPACName = Disodium 3-carboxy-3-hydroxypentanedioate{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/8950#section=IUPAC-Name&fullscreen=true | title=Disodium citrate }}

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| PubChem = 8950

| ChemSpiderID = 8606

| EINECS = 205-623-3

| RTECS = GE7580000

| InChI = 1S/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2

| InChIKey = CEYULKASIQJZGP-UHFFFAOYSA-L

| SMILES = C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O.[Na+].[Na+]

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 144-33-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6FO62KCQ7A

}}

| Section2 = {{Chembox Properties

| C = 6 | H = 6 | O = 7 | Na = 2

| Appearance = white crystalline powder

| MeltingPtC = 149

}}

| Section7 = {{Chembox Hazards

| NFPA-H = 0

| NFPA-F = 1

| NFPA-R = 0

}}

}}

Disodium citrate, also known as disodium hydrogen citrate, (Neo-Alkacitron) and sesquihydrate, is an acid salt of citric acid with the chemical formula {{chem2|Na2C6H6O7}}.{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}} It is used as an antioxidant in food and to improve the effects of other antioxidants. It is also used as an acidity regulator and sequestrant. Typical products include gelatin, jam, sweets, ice cream, carbonated beverages, milk powder, wine, and processed cheeses.

Uses

= Food =

It is used as an antioxidant in food and to improve the effects of other antioxidants.{{cite web | url = http://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | title = Alkarate from Macleods: Disodium Hydrogen Citrate | publisher = drugsupdate.com | access-date = 2013-04-20 | archive-date = 2020-07-25 | archive-url = https://web.archive.org/web/20200725080700/https://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | url-status = dead }} It is also used as an acidity regulator and sequestrant. Typical products include gelatin, jam, sweets, ice cream, carbonated beverages, milk powder, wine, and processed cheeses. Disodium citrate can also be used as a thickening agent or stabilizer.{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}}

= Manufacturing =

Disodium citrate can also be used as an ingredient in household products that remove stains.{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-09-19 |website=pubchem.ncbi.nlm.nih.gov |language=en}}

= Health =

Disodium citrate may be used in patients to alleviate discomfort from urinary-tract infections.{{cite web | url = https://glowpink.com/blog/cital-syrup/ | title = OTC Treatment | access-date = 2016-04-19 | archive-date = 2018-07-28 | archive-url = https://web.archive.org/web/20180728002859/https://glowpink.com/blog/cital-syrup/ | url-status = dead }}{{Cite web |title=Disodium Hydrogen Citrate Syrup |url=https://labeling.pfizer.com/ShowLabeling.aspx?id=14817 |access-date=2022-09-26 |website=labeling.pfizer.com}}

References