Disperse Orange 1
{{Short description|Chemical compound}}
{{chembox
| Watchedfields = changed
| verifiedrevid = 414585451
| Name = Disperse Orange 1
| ImageFile = Disperse Orange 1.svg
| ImageSize = 250px
| ImageName = Chemical structure of Disperse Orange 1
| IUPACName =
| OtherNames = 4-Anilino-4'-nitroazobenzene
C.I. 11080 (Colour index numbers)
| Section2 = {{Chembox Properties
| Formula = C18H14N4O2
| MolarMass = 318.33476 g/mol
| MeltingPtC = 160.0
}}
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|chemspider}}
| CASNo = 2581-69-3
| EINECS = 219-954-6
| ChemSpiderID = 16477
| PubChem = 17414
| UNII = 1592R4P97H
| StdInChI=1S/C18H14N4O2/c23-22(24)18-12-10-17(11-13-18)21-20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19H
| StdInChIKey = YFVXLROHJBSEDW-UHFFFAOYSA-N
| SMILES = C1=CC=C(C=C1)NC2=CC=C(C=C2)N=NC3=CC=C(C=C3)[N+](=O)[O-]
}}
| Section7 = {{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|317}}
| PPhrases = {{P-phrases|261|272|280|302+352|321|333+313|363|501}}
}}
}}
Disperse Orange 1, or 4-anilino-4'-nitroazobenzene, is an azo dye. Commercial samples contain approximately 25% dye by weight, with the remaining mass consisting of NaCl and other salts.
This dye is useful in conducting experiments with flash photolysis due to the isomerization effect between the trans-4A4N and cis-4A4N states that occurs during photo relaxation.{{cite journal|author1=Hair, S. R. |author2=Taylor, G. A. |author3=Schultz, L. W. J. |title=An Easily Implemented Flash Photolysis Experiment for the Physical Chemistry Laboratory: the Isomerization of 4-Anilino-4'-Nitroazobenzene|journal=Journal of Chemical Education|year=1990|volume=67|issue=8|page=709|doi=10.1021/ed067p709|bibcode=1990JChEd..67..709H }}Wildes, P. D.; Pacifici, J. G.; Irick, G.; Whitten, D. G. J. Am. Chem. Soc., 1971, 93, 2004.