Disperse Yellow 42

{{short description|Chemical compound}}

{{Chembox

| ImageFile = DispYell42.png

| ImageSize =

| ImageAlt =

| PIN = 4-Anilino-3-nitro-N-phenylbenzene-1-sulfonamide

| OtherNames = 4-Anilino-3-nitrobenzenesulfonanilide
C.I. 10338 (Colour index numbers)

|Section1={{Chembox Identifiers

| CASNo = 5124-25-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XFL4U655CN

| PubChem = 21201

| EC_number = 225-862-7

| ChEMBL = 1708990

| ChemSpiderID = 19933

| DTXSID = DTXSID8052148

| StdInChI=1S/C18H15N3O4S/c22-21(23)18-13-16(26(24,25)20-15-9-5-2-6-10-15)11-12-17(18)19-14-7-3-1-4-8-14/h1-13,19-20H

| StdInChIKey = BBFRYSKTTHYWQZ-UHFFFAOYSA-N

| SMILES = C1=CC=C(C=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC3=CC=CC=C3)[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| C=18|H=15|N=3|O=4|S=1

| MolarMass =

| Appearance =

| Density =

| MeltingPtC = 156

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|317|411|412}}

| PPhrases = {{P-phrases|261|272|273|280|302+352|321|333+313|363|391|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Disperse Yellow 42, or 4-anilino-3-nitrobenzenesulfonanilide, is a disperse dye that is primarily used to dye polyester fibers. It is prepared by the reaction of two equivalents of aniline with 4-chloro-3-nitrobenzenesulfonyl chloride. An estimated 10,000 tons were prepared in 1990, making Disperse Yellow 42 the nitro dye produced on the largest scale.{{Ullmann|doi=10.1002/14356007.a17_383|title=Nitro and Nitroso Dyes|year=2000|last1=Raue|first1=Roderich|last2=Corbett|first2=John F.|isbn=3527306730}}{{cite journal|doi=10.1016/0143-7208(92)80044-N|title=An approach to the design of lightfast disperse dyes-analogs of disperse yellow 42|year=1992|last1=Freeman|first1=Harold S.|last2=Posey|first2=James C.|journal=Dyes and Pigments|volume=20|issue=3|pages=171–195}}