Drotebanol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461091590

| IUPAC_name = 3,4-Dimethoxy-17-methylmorphinan-6β,14-diol

| image = Drotebanol.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| Drugs.com = {{drugs.com|international|drotebanol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU = S8

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule I

| legal_UK =

| legal_US = Schedule I

| legal_DE = Anlage I

| legal_status = SE: Förteckning II

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 3176-03-2

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104603

| PubChem = 5463863

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01547

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16736125

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7RS2Q8MCK8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01496

| C=19 | H=27 | N=1 | O=4

| smiles = CN1CC[C@]23C[C@@H](CC[C@]2([C@H]1CC4=C3C(=C(C=C4)OC)OC)O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H27NO4/c1-20-9-8-18-11-13(21)6-7-19(18,22)15(20)10-12-4-5-14(23-2)17(24-3)16(12)18/h4-5,13,15,21-22H,6-11H2,1-3H3/t13-,15-,18-,19-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LCAHPIFLPICNRW-SVYNMNNPSA-N

| synonyms = Drotebanol, Oxymethebanol

| melting_point = 165

| melting_high = 167

}}

Drotebanol (Oxymethebanol) is a morphinan derivative that acts as an opioid agonist. It was invented by Sankyo Company in Japan during the 1970s. It is synthesised from thebaine.

Drotebanol has powerful antitussive (cough suppressant) effects, and is around 10x more potent than codeine in producing this effect. It also has analgesic effects several times stronger than codeine, but weaker than morphine.{{cite journal | vauthors = Kobayashi S, Hasegawa K, Mori M, Takagi H | title = Pharmacological studies on a new specifically potent antitussive agent, 14-hydroxydihydro-6 beta-thebainol-4-methylether (oxymethebanol) | journal = Arzneimittel-Forschung | volume = 20 | issue = 1 | pages = 43–46 | date = January 1970 | pmid = 5467447 }} In animal studies it was found to be moderately addictive and produced limited physical dependence, but not as severe as that seen with morphine or pethidine.{{cite journal | vauthors = Yanagita T, Miyasato K, Oinuma N, Yiyohara H | title = Dependence potential of drotebanol, codeine and thebaine tested in rhesus monkeys | journal = Bulletin on Narcotics | volume = 29 | issue = 1 | pages = 33–46 | date = 1977 | pmid = 405065 | url = http://www.unodc.org/unodc/en/data-and-analysis/bulletin/bulletin_1977-01-01_1_page005.html }} It was previously marketed for human use under the brand name Metebanyl, although it is now no longer used in medicine.

It is currently a Schedule I Narcotic controlled substance in the United States with a DEA ACSCN of 9335 and an annual aggregate manufacturing quota of zero.

References