Duclauxin

{{Chembox

| ImageFile = Duclauxin.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 1732-37-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y76N2QE4RZ

| ChemSpiderID = 68003973

| PubChem = 10482567

| SMILES = CC1=CC(=C2C3=C1C(=O)[C@H]4[C@H]([C@]3(COC2=O)[C@@H]5[C@]4(C6=C7C(=COC(=O)C7=C(C=C6C)O)C5=O)OC)OC(=O)C)O

| StdInChI=1S/C29H22O11/c1-9-5-14(32)18-20-15(9)23(34)21-25(40-11(3)30)28(20,8-39-27(18)36)24-22(33)12-7-38-26(35)17-13(31)6-10(2)19(16(12)17)29(21,24)37-4/h5-7,21,24-25,31-32H,8H2,1-4H3/t21-,24+,25+,28-,29+/m0/s1

| StdInChIKey = WBQDAYWQELBEPU-FTAQWXBTSA-N

}}

|Section2={{Chembox Properties

| C=29 | H=22 | O=11

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Duclauxin is a chemical compound isolated from Penicillium duclauxi.{{cite journal|pmid=4799788|year=1973|last1=Kuhr|first1=I|last2=Fuska|first2=J|last3=Sedmera|first3=P|last4=Podojil|first4=M|last5=Vokoun|first5=J|last6=Vanĕk|first6=Z|title=An antitumor antibiotic produced by Penicillium stipitatum Thom; its identity with duclauxin|volume=26|issue=9|pages=535–6|journal=The Journal of Antibiotics|doi=10.7164/antibiotics.26.535|doi-access=free}}

Other chemical compounds which are derivatives of duclauxin are known,{{cite journal | doi = 10.3389/fmicb.2021.766440 | doi-access = free | title = Duclauxin Derivatives from Fungi and Their Biological Activities | year = 2021 | last1 = Shahid | first1 = Hamza | last2 = Cai | first2 = Teng | last3 = Wang | first3 = Yuyang | last4 = Zheng | first4 = Caiqing | last5 = Yang | first5 = Yuting | last6 = Mao | first6 = Ziling | last7 = Ding | first7 = Ping | last8 = Shan | first8 = Tijiang | journal = Frontiers in Microbiology | volume = 12 | pmc = 8727740 }} such as cryptoclauxin, bacillisporins, and talaromycesones. They are sometimes referred to collectively as duclauxins.{{cite journal | doi = 10.1021/jacs.8b03705 | title = Biosynthesis of Heptacyclic Duclauxins Requires Extensive Redox Modifications of the Phenalenone Aromatic Polyketide | year = 2018 | last1 = Gao | first1 = Shu-Shan | last2 = Zhang | first2 = Tao | last3 = Garcia-Borràs | first3 = Marc | last4 = Hung | first4 = Yiu-Sun | last5 = Billingsley | first5 = John M. | last6 = Houk | first6 = K. N. | last7 = Hu | first7 = Youcai | last8 = Tang | first8 = Yi | journal = Journal of the American Chemical Society | volume = 140 | issue = 22 | pages = 6991–6997 | pmid = 29741874 | pmc = 6309916 }}

File:cryptoclauxin.svg|Cryptoclauxin

File:Bacillisporin C.svg|Bacillisporin C

File:Bacillisporin F.svg|Bacillisporin F

File:Talaromycesone B.svg|Talaromycesone B

Notes

{{reflist}}

Category:Penicillium

Category:Isocoumarins

{{Ether-stub}}