EDTMP
{{chembox
| Watchedfields = changed
| verifiedrevid = 443718549
| ImageFile = EDTMP.png
| PIN={Ethane-1,2-diylbis[nitrilobis(methylene)]}tetrakis(phosphonic acid)
| OtherNames=Ethylenediamine tetra(methylene phosphonic acid), EDTMP
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 14301
| InChI = 1/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)
| InChIKey = NFDRPXJGHKJRLJ-UHFFFAOYAV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NFDRPXJGHKJRLJ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo= 1429-50-1
| PubChem = 15025
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V4CP8RSX7V
| SMILES = O=P(O)(O)CN(CP(=O)(O)O)CCN(CP(=O)(O)O)CP(=O)(O)O
}}
|Section2={{Chembox Properties
| Formula=C6H20N2O12P4
| MolarMass = 436.13
| Appearance= solid
| Density=
| MeltingPt=
| BoilingPt=
| Solubility= limited
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
EDTMP or ethylenediamine tetra(methylene phosphonic acid) is a phosphonic acid. It has chelating and anti corrosion properties. EDTMP is the phosphonate analog of EDTA.Svara, J.; Weferling, N.; Hofmann, T. "Phosphorus Compounds, Organic," In 'Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2008. {{doi|10.1002/14356007.a19_545.pub2}}. It is classified as a nitrogenous organic polyphosphonic acid.
__TOC__
Properties and applications
EDTMP is normally delivered as its sodium salt, which exhibits good solubility in water.
Used in water treatment as an antiscaling and anti corrosion agent, the corrosion inhibition of EDTMP is 3–5 times better than that of inorganic polyphosphate. It can degrade to Aminomethylphosphonic acid.{{cite journal | last=Klinger | first=J. | last2=Lang | first2=M. | last3=Sacher | first3=F. | last4=Brauch | first4=H.-J. | last5=Maier | first5=D. | last6=Worch | first6=E. | title=Formation of Glyphosate and AMPA During Ozonation of Waters Containing Ethylenediaminetetra(methylenephosphonic acid) | journal=Ozone: Science & Engineering | volume=20 | issue=2 | date=1998 | issn=0191-9512 | doi=10.1080/01919519808547279 | pages=99–110}} It shows excellent scale inhibition ability under temperature 200 °C. It functions by chelating with many metal ions.
The anti-cancer drug Samarium (153Sm) lexidronam is also derived from EDTMP.