EGLU

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444652213

| IUPAC_name = (2S)-2-Amino-2-ethylpentanedioic acid

| image = (2S)-α-ethylglutamic acid.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|yes}}

| CAS_number = 170984-72-2

| ATC_prefix =

| ATC_suffix =

| PubChem = 5311079

| IUPHAR_ligand = 1400

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4470613

| smiles = O=C(O)CC[C@](N)(C(=O)O)CC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C7H13NO4/c1-2-7(8,6(11)12)4-3-5(9)10/h2-4,8H2,1H3,(H,9,10)(H,11,12)/t7-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QFYBYZLHPIALCZ-ZETCQYMHSA-N

| C=7 | H=13 | N=1 | O=4

}}

EGLU ((2S)-α-ethylglutamic acid ) is a drug that is used in neuroscience research. It was one of the first compounds found that acts as a selective antagonist for the group II metabotropic glutamate receptors (mGluR_2/3), and so has been useful in the characterization and study of this receptor subfamily.{{cite journal | vauthors = Jane DE, Thomas NK, Tse HW, Watkins JC | title = Potent antagonists at the L-AP4- and (1S,3S)-ACPD-sensitive presynaptic metabotropic glutamate receptors in the neonatal rat spinal cord | journal = Neuropharmacology | volume = 35 | issue = 8 | pages = 1029–35 | year = 1996 | pmid = 9121605 | doi = 10.1016/S0028-3908(96)00048-2 | s2cid = 6238847 }}{{cite journal | vauthors = Huang L, Rowan MJ, Anwyl R | title = Induction of long-lasting depression by (+)-alpha-methyl-4-carboxyphenylglycine and other group II mGlu receptor ligands in the dentate gyrus of the hippocampus in vitro | journal = European Journal of Pharmacology | volume = 366 | issue = 2–3 | pages = 151–8 | date = February 1999 | pmid = 10082195 | doi = 10.1016/S0014-2999(98)00918-2 }}{{cite journal | vauthors = Palazzo E, Marabese I, de Novellis V, Oliva P, Rossi F, Berrino L, Rossi F, Maione S | display-authors = 6 | title = Metabotropic and NMDA glutamate receptors participate in the cannabinoid-induced antinociception | journal = Neuropharmacology | volume = 40 | issue = 3 | pages = 319–26 | date = March 2001 | pmid = 11166324 | doi = 10.1016/S0028-3908(00)00160-X | s2cid = 41189905 }}{{cite journal | vauthors = Iserhot C, Gebhardt C, Schmitz D, Heinemann U | title = Glutamate transporters and metabotropic receptors regulate excitatory neurotransmission in the medial entorhinal cortex of the rat | journal = Brain Research | volume = 1027 | issue = 1–2 | pages = 151–60 | date = November 2004 | pmid = 15494166 | doi = 10.1016/j.brainres.2004.08.052 | s2cid = 33373525 }}{{cite journal | vauthors = Cahusac PM, Wan H | title = Group II metabotropic glutamate receptors reduce excitatory but not inhibitory neurotransmission in rat barrel cortex in vivo | journal = Neuroscience | volume = 146 | issue = 1 | pages = 202–12 | date = April 2007 | pmid = 17346894 | doi = 10.1016/j.neuroscience.2007.01.049 | s2cid = 37975672 }}{{cite journal | vauthors = Kim WY, Vezina P, Kim JH | title = Blockade of group II, but not group I, mGluRs in the rat nucleus accumbens inhibits the expression of conditioned hyperactivity in an amphetamine-associated environment | journal = Behavioural Brain Research | volume = 191 | issue = 1 | pages = 62–6 | date = August 2008 | pmid = 18433894 | doi = 10.1016/j.bbr.2008.03.010 | s2cid = 24250755 }}{{cite journal | vauthors = Altinbilek B, Manahan-Vaughan D | title = A specific role for group II metabotropic glutamate receptors in hippocampal long-term depression and spatial memory | journal = Neuroscience | volume = 158 | issue = 1 | pages = 149–58 | date = January 2009 | pmid = 18722513 | doi = 10.1016/j.neuroscience.2008.07.045 | s2cid = 40251815 }}