EHNA

{{Short description|Chemical compound}}

{{Technical|date=March 2021}}

{{Infobox drug

| verifiedrevid = 403603363

| IUPAC_name = 3-(6-aminopurin-9-yl)nonan-2-ol

| image = EHNA.svg

| width = 180

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 59262-86-1

| ATC_prefix =

| ATC_suffix =

| PubChem = 3206

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 50378

| ChemSpiderID = 3094

| C=14 | H=23 | N=5 | O=1

| smiles = CCCCCCC(C(C)O)n1cnc2c1ncnc2N

| StdInChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17)

| StdInChIKey = IOSAAWHGJUZBOG-UHFFFAOYSA-N

}}

EHNA (erythro-9-(2-hydroxy-3-nonly)adenine) is a potent adenosine deaminase inhibitor,{{cite web|title=Sigma Aldrich|url=http://www.sigmaaldrich.com/catalog/product/sigma/e114?lang=en®ion=US|access-date=16 January 2013}} which also acts as a phosphodiesterase inhibitor that selectively inhibits phosphodiesterase type 2 (PDE2).{{cite journal | vauthors = Podzuweit T, Nennstiel P, Müller A | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | journal = Cellular Signalling | volume = 7 | issue = 7 | pages = 733–8 | date = September 1995 | pmid = 8519602 | doi = 10.1016/0898-6568(95)00042-N }}{{cite journal | vauthors = Méry PF, Pavoine C, Pecker F, Fischmeister R | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | journal = Molecular Pharmacology | volume = 48 | issue = 1 | pages = 121–30 | date = July 1995 | doi = 10.1016/S0026-895X(25)10036-9 | pmid = 7623766 | url = https://hal-universite-paris-saclay.archives-ouvertes.fr/hal-03618412/file/13232.pdf }}