EMDA-2

{{Distinguish|EDMA}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = EMDA-2.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Oral

| class = Serotonergic psychedelic; Hallucinogen

| ATC_prefix = None

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number =

| CAS_supplemental =

| PubChem = 61612198

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 34243401

| UNII =

| KEGG =

| ChEBI =

| ChEMBL = 3246881

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 2-Ethoxy-MMDA-2; 2-EtO-MMDA-2; 2-Ethoxy-4,5-methylenedioxyamphetamine

| IUPAC_name = 1-(6-ethoxy-1,3-benzodioxol-5-yl)propan-2-amine

| C=12 | H=17 | N=1 | O=3

| SMILES = CCOC1=CC2=C(C=C1CC(C)N)OCO2

| StdInChI = 1S/C12H17NO3/c1-3-14-10-6-12-11(15-7-16-12)5-9(10)4-8(2)13/h5-6,8H,3-4,7,13H2,1-2H3

| StdInChIKey = OHOFHHFTTSOJCK-UHFFFAOYSA-N

}}

EMDA-2, also known as 2-ethoxy-4,5-methylenedioxyamphetamine, is a psychedelic drug of the phenethylamine and methylenedioxyamphetamine families.{{CitePiHKAL }} "The Tweetio homologue of MMDA-2 has been tasted, however. This is 2-ethoxy-4,5-methylenedioxyamphetamine, or EMDA-2. [...] At 135 milligrams, there have been reported eyes-closed visual phenomena, with intense colors. The overall duration is similar to MMDA-2 (some 10 hours) and there are reported sleep disturbances. At 185 milligrams, the feelings were intensified, there were “marvelous eyes-closed visuals (the colors were incredible), good concentration, but distinct body-tingles and rushes.” The time span was about 12 hours from start to finish, but it proved to be impossible to sleep afterwards. This homologue is thus about a third the potency of MMDA-2."{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine: von der Struktur zur Funktion | location = Solothurn | pages = 828–829 | year = 2013 | trans-title = Phenethylamines: From Structure to Function | edition = 1 | publisher = Nachtschatten-Verlag | series = Nachtschatten-Science | isbn = 978-3-03788-700-4 | oclc = 858805226 | url = https://books.google.com/books?id=-Us1kgEACAAJ | language = de | access-date = 31 January 2025 }}{{cite book | vauthors = Brimblecombe RW, Pinder RM | chapter = Phenylalkylamines and Their Derivatives | title = Hallucinogenic Agents | location = Bristol | pages = 55–97 | date = 1975 | publisher = Wright-Scientechnica | url = https://bitnest.netfirms.com/external/Books/978-0-85608-011-1 }} It is the analogue of MMDA-2 in which the 2-methoxy group has been replaced with a 2-ethoxy group. This has resulted in EMDA-2 being described as the "TWEETIO" analogue of MMDA-2.