ETFELA

{{Short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = (6aR,9R)-N-Ethyl-7-methyl-N-(2,2,2-trifluoroethyl)-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide

| image = ETFELA.svg

| width = 180

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_US_comment =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 3024529-99-2

| PubChem = 163187757

| ChemSpiderID =

| C=20 | H=22 | F=3 | N=3 | O=1

| smiles = CCN(C(=O)[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)CC(F)(F)F

| StdInChI = 1S/C20H22F3N3O/c1-3-26(11-20(21,22)23)19(27)13-7-15-14-5-4-6-16-18(14)12(9-24-16)8-17(15)25(2)10-13/h4-7,9,13,17,24H,3,8,10-11H2,1-2H3/t13-,17-/m1/s1

| StdInChIKey = VAHPXTJQSWECIC-CXAGYDPISA-N

| synonyms = LA-CH₂CF₃

}}

ETFELA (N-ethyl-N-(2,2,2-trifluoroethyl)lysergamide) is an analog of lysergic acid diethylamide (LSD) first synthesised by Jason C. Parrish as part of the research team led by David E. Nichols. In studies in vitro, it was found to be slightly more potent than LSD itself.{{cite journal | last1 = Nichols| first1 = David E. | name-list-style = vanc | title = Structure-activity relationships of serotonin 5-HT_2A agonists| journal = Wiley Interdisciplinary Reviews: Membrane Transport and Signaling| volume = 1| issue = 5| pages = 559–579| year = 2012 | doi = 10.1002/wmts.42 | doi-access = free}}{{cite book | vauthors = Nichols DE | title = Behavioral Neurobiology of Psychedelic Drugs | s2cid = 4396184 | chapter = Chemistry and Structure-Activity Relationships of Psychedelics | series = Current Topics in Behavioral Neurosciences| volume = 36 | pages = 1–43 | year = 2017 | pmid = 28401524 | doi = 10.1007/7854_2017_475 | isbn = 978-3-662-55878-2 }}