Econazole

{{Short description|Antifungal medication}}

{{Use dmy dates|date=January 2020}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 461092342

| drug_name =

| INN =

| type =

| chirality = Racemic mixture

| image = Econazole.svg

| width =

| alt =

| caption =

| pronounce =

| tradename = Spectazole, Ecostatin, others

| Drugs.com = {{drugs.com|monograph|econazole-nitrate}}

| MedlinePlus = a684049

| licence_CA =

| licence_EU =

| DailyMedID = Econazole

| licence_US =

| pregnancy_AU = A

| pregnancy_AU_comment = {{cite web | title=Econazole topical Use During Pregnancy | website=Drugs.com | date=3 September 2018 | url=https://www.drugs.com/pregnancy/econazole-topical.html | access-date=31 January 2020}}

| pregnancy_category=

| routes_of_administration = Topical

| class =

| ATCvet =

| ATC_prefix = D01

| ATC_suffix = AC03

| ATC_supplemental = {{ATC|G01|AF05}}

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Spectazole (econazole nitrate 1%) Cream | work = DailyMed | publisher = U.S. National Library of Medicine | date=30 September 2013 | url=https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=121775 | access-date=31 July 2021}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 27220-47-9

| CAS_supplemental =

| PubChem = 3198

| IUPHAR_ligand = 2446

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01127

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3086

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6Z1Y2V4A7M

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D03936

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 4754

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 808

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = (RS)-1-{2-[(4-Chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole

| C=18 | H=15 | Cl=3 | N=2 | O=1

| SMILES = Clc1ccc(c(Cl)c1)C(OCc2ccc(Cl)cc2)Cn3ccnc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H15Cl3N2O/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21/h1-9,12,18H,10-11H2

| StdInChI_comment =

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LEZWWPYKPKIXLL-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Econazole is an antifungal medication of the imidazole class.{{cite journal | vauthors = Thienpont D, Van Cutsem J, Van Nueten JM, Niemegeers CJ, Marsboom R | title = Bilogical and toxicological properties of econazole, a broad-spectrum antimycotic | journal = Arzneimittel-Forschung | volume = 25 | issue = 2 | pages = 224–230 | date = February 1975 | pmid = 1173036 }}

It was patented in 1968, and approved for medical use in 1974.{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=502 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA502 }}