Edoxudine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443802525

| IUPAC_name = 5-ethyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione

| image = Edoxudin.svg

| alt =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 15176-29-1

| ATCvet =

| ATC_prefix = D06

| ATC_suffix = BB09

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13421

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 15ZQM81Y3R

| PubChem = 66377

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 318153

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59752

| smiles = O=C/1NC(=O)N(\C=C\1CC)[C@@H]2O[C@@H]([C@@H](O)C2)CO

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C11H16N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,2-3,5H2,1H3,(H,12,16,17)/t7-,8+,9+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XACKNLSZYYIACO-DJLDLDEBSA-N

| C = 11 | H = 16 | N = 2 | O = 5

}}

Edoxudine (or edoxudin) is an antiviral drug. It is an analog of thymidine, a nucleoside.

It has shown effectiveness against herpes simplex virus.{{cite journal | vauthors = Hamuy R, Berman B | title = Topical antiviral agents for herpes simplex virus infections | journal = Drugs of Today | volume = 34 | issue = 12 | pages = 1013–1025 | date = December 1998 | pmid = 14743269 | doi = 10.1358/dot.1998.34.12.487486 }}