Efloxate
{{Short description|Chemical compound}}
{{more citations needed|date=February 2022}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 444355205
| IUPAC_name = ethyl 2-[(4-oxo-2-phenyl-4H-chromen-7-yl)oxy]acetate
| image = Efloxate.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 119-41-5
| ATC_prefix = C01
| ATC_suffix = DX13
| PubChem = 8395
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = CZU6V3902K
| ChemSpiderID = 8089
| ChEMBL = 1349073
| C=19 | H=16 | O=5
| smiles = CCOC(=O)COc1ccc2c(=O)cc(oc2c1)c3ccccc3
| StdInChI = 1S/C19H16O5/c1-2-22-19(21)12-23-14-8-9-15-16(20)11-17(24-18(15)10-14)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3
| StdInChIKey = ZVXBAHLOGZCFTP-UHFFFAOYSA-N
}}
Efloxate is a vasodilator.{{cite journal | vauthors = Tomasi AM, Masoni A | title = [Clinical research on the therapeutic efficacy and tolerance of long-acting efloxate in angina pectoris] | language = Italian | journal = La Clinica Terapeutica | volume = 82 | issue = 3 | pages = 227–41 | date = August 1977 | pmid = 334448 | doi = | url = }}
References
{{Reflist}}
{{Vasodilators used in cardiac diseases}}
{{cardiovascular-drug-stub}}