Elopiprazole

{{Short description|Antipsychotic drug}}

{{Drugbox

| IUPAC_name = 1-(1-benzofuran-7-yl)-4-[[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl]piperazine

| image = Elopiprazole.svg

| width = 260

| image2 = Elopiprazole ball-and-stick model.png

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 115464-77-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 208917

| ChemSpiderID = 181013

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 419A0R564U

| ChEMBL = 292187

| C=23 | H=22 | F=1 | N=3 | O=1

| smiles = Fc1ccc(cc1)c2ccc([nH]2)CN5CCN(c4cccc3c4occ3)CC5

}}

Elopiprazole is an antipsychotic drug of the phenylpiperazine class which was never marketed.{{cite journal |vauthors=van Wijngaarden I, Kruse CG, van Hes R, van der Heyden JA, Tulp MT | title = 2-Phenylpyrroles as conformationally restricted benzamide analogues. A new class of potential antipsychotics. 1 | journal = Journal of Medicinal Chemistry | volume = 30 | issue = 11 | pages = 2099–104 |date=November 1987 | pmid = 2889830 | doi = 10.1021/jm00394a028}}