Emavusertib

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{drugbox

| drug_name = Emavusertib

| image = Emavusertib.svg

| legal_UK =

| legal_DE =

| C = 24 | H = 25 | N = 7 | O = 5

| IUPAC_name = N-[5-[(3R)-3-hydroxypyrrolidin-1-yl]-2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridin-6-yl]-2-(2-methylpyridin-4-yl)-1,3-oxazole-4-carboxamide

| CAS_number = 1801344-14-8

| CAS_supplemental =

| ChemSpiderID = 84492187

| PubChem = 118224491

| UNII = MH5DMF9JKY

| ChEMBL = 4783351

| DrugBank = DB18060

| smiles = CC1=NC=CC(=C1)C2=NC(=CO2)C(=O)NC3=CC4=C(N=C3N5CC[C@H](C5)O)N=C(O4)N6CCOCC6

| StdInChI = 1S/C24H25N7O5/c1-14-10-15(2-4-25-14)23-27-18(13-35-23)22(33)26-17-11-19-20(28-21(17)31-5-3-16(32)12-31)29-24(36-19)30-6-8-34-9-7-30/h2,4,10-11,13,16,32H,3,5-9,12H2,1H3,(H,26,33)/t16-/m1/s1

| StdInChIKey = SJHNWSAWWOAWJH-MRXNPFEDSA-N

}}

Emavusertib (CA-4948) is a drug which acts as a selective inhibitor of the enzyme Interleukin-1 receptor-associated kinase 4 (IRAK-4) and was developed for the treatment of some forms of cancer.{{cite journal | vauthors = Gummadi VR, Boruah A, Ainan BR, Vare BR, Manda S, Gondle HP, Kumar SN, Mukherjee S, Gore ST, Krishnamurthy NR, Marappan S, Nayak SS, Nellore K, Balasubramanian WR, Bhumireddy A, Giri S, Gopinath S, Samiulla DS, Daginakatte G, Basavaraju A, Chelur S, Eswarappa R, Belliappa C, Subramanya HS, Booher RN, Ramachandra M, Samajdar S | title = Discovery of CA-4948, an Orally Bioavailable IRAK4 Inhibitor for Treatment of Hematologic Malignancies | journal = ACS Medicinal Chemistry Letters | volume = 11 | issue = 12 | pages = 2374–2381 | date = December 2020 | pmid = 33335659 | doi = 10.1021/acsmedchemlett.0c00255 | pmc = 7734642 }}{{cite journal | vauthors = Von Roemeling CA, Doonan BP, Klippel K, Schultz D, Hoang-Minh L, Trivedi V, Li C, Russell RA, Kanumuri RS, Sharma A, Tun HW, Mitchell DA | title = Oral IRAK-4 Inhibitor CA-4948 Is Blood-Brain Barrier Penetrant and Has Single-Agent Activity against CNS Lymphoma and Melanoma Brain Metastases | journal = Clinical Cancer Research | volume = 29 | issue = 9 | pages = 1751–1762 | date = May 2023 | pmid = 36749885 | doi = 10.1158/1078-0432.CCR-22-1682 | pmc = 10150246 }}{{cite journal | vauthors = Parrondo RD, Iqbal M, Von Roemeling R, Von Roemeling C, Tun HW | title = IRAK-4 inhibition: emavusertib for the treatment of lymphoid and myeloid malignancies | journal = Frontiers in Immunology | date = 2023 | volume = 14 | pages = 1239082 | pmid = 37954584 | doi = 10.3389/fimmu.2023.1239082 | doi-access = free | pmc = 10637517 }}

See also

References