Emepronium bromide
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 406008902
| IUPAC_name = N-ethyl-N,N-dimethyl-4,4-diphenylbutan-2-aminium
| image = Emepronium.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3614-30-0
| ATC_prefix = G04
| ATC_suffix = BD01
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = WZM699L2TL
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07224
| PubChem = 71820
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 64844
| C=20 | H=28 | N=1 | Br=1
| smiles = CC[N+](C)(C)C(C)CC(c1ccccc1)c2ccccc2.[Br-]
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H28N.BrH/c1-5-21(3,4)17(2)16-20(18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17,20H,5,16H2,1-4H3;1H/q+1;/p-1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UVKFSMBPRQBNCH-UHFFFAOYSA-M
}}
Emepronium (as emepronium bromide) is an anticholinergic drug used in urology as an antispasmodic.
It can cause ulceration of esophagus, so it should be taken in orthostatic position with sufficient amounts of liquids.{{cite journal | vauthors = Puhakka HJ | title = Esophageal ulceration due to oral medications | journal = ORL; Journal for Oto-Rhino-Laryngology and Its Related Specialties | volume = 49 | issue = 6 | pages = 321–6 | year = 1987 | pmid = 3431840 | doi = 10.1159/000275958 }}
References
{{Reflist}}
{{Urologicals}}
{{Muscarinic acetylcholine receptor modulators}}
Category:M1 receptor antagonists
Category:M2 receptor antagonists
Category:M3 receptor antagonists
Category:M4 receptor antagonists
Category:M5 receptor antagonists
Category:Quaternary ammonium compounds
{{genito-urinary-drug-stub}}