Enitociclib
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name = Enitociclib
| INN =
| type =
| image = Enitociclib.svg
| width =
| alt =
| caption =
| image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| CAS_number = 1610408-97-3
| CAS_supplemental =
| PubChem = 139593425
| IUPHAR_ligand = 11686
| DrugBank = DB17297
| ChemSpiderID = 81367557
| ChEBI = 231682
| UNII = 1255AT22ZJ
| KEGG =
| ChEMBL = 4762845
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name = 5-fluoro-4-(4-fluoro-2-methoxyphenyl)-N-[4-[(methylsulfonimidoyl)methyl]pyridin-2-yl]pyridin-2-amine
| chemical_formula =
| C=19 | H=18 | F=2 | N=4 | O=2 | S=1
| SMILES = COC1=C(C=CC(=C1)F)C2=CC(=NC=C2F)NC3=NC=CC(=C3)C[S@@](=N)(=O)C
| Jmol =
| StdInChI = nChI=1S/C19H18F2N4O2S/c1-27-17-8-13(20)3-4-14(17)15-9-19(24-10-16(15)21)25-18-7-12(5-6-23-18)11-28(2,22)26/h3-10,22H,11H2,1-2H3,(H,23,24,25)/t28-/m0/s1
| StdInChI_comment =
| StdInChIKey = YZCUMZWULWOUMD-NDEPHWFRSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Enitociclib is an experimental drug that is being investigated for the treatment of cancer.{{cite web | url = https://adisinsight.springer.com/drugs/800044155 | title = Enitociclib - Vincerx Pharma | work = AdisInsight | publisher = Springer Nature Switzerland AG }} It is an inhibitor of the kinase CDK9.{{cite journal | vauthors = Morillo D, Vega G, Moreno V | title = CDK9 INHIBITORS: a promising combination partner in the treatment of hematological malignancies | journal = Oncotarget | volume = 14 | issue = | pages = 749–752 | date = August 2023 | pmid = 37552223 | pmc = 10408673 | doi = 10.18632/oncotarget.28473 }}{{cite journal | vauthors = Frigault MM, Mithal A, Wong H, Stelte-Ludwig B, Mandava V, Huang X, Birkett J, Johnson AJ, Izumi R, Hamdy A | title = Enitociclib, a Selective CDK9 Inhibitor, Induces Complete Regression of MYC+ Lymphoma by Downregulation of RNA Polymerase II Mediated Transcription | journal = Cancer Research Communications | volume = 3 | issue = 11 | pages = 2268–2279 | date = November 2023 | pmid = 37882668 | pmc = 10634346 | doi = 10.1158/2767-9764.CRC-23-0219 }}