Enitociclib

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Enitociclib

| INN =

| type =

| image = Enitociclib.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 1610408-97-3

| CAS_supplemental =

| PubChem = 139593425

| IUPHAR_ligand = 11686

| DrugBank = DB17297

| ChemSpiderID = 81367557

| ChEBI = 231682

| UNII = 1255AT22ZJ

| KEGG =

| ChEMBL = 4762845

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 5-fluoro-4-(4-fluoro-2-methoxyphenyl)-N-[4-[(methylsulfonimidoyl)methyl]pyridin-2-yl]pyridin-2-amine

| chemical_formula =

| C=19 | H=18 | F=2 | N=4 | O=2 | S=1

| SMILES = COC1=C(C=CC(=C1)F)C2=CC(=NC=C2F)NC3=NC=CC(=C3)C[S@@](=N)(=O)C

| Jmol =

| StdInChI = nChI=1S/C19H18F2N4O2S/c1-27-17-8-13(20)3-4-14(17)15-9-19(24-10-16(15)21)25-18-7-12(5-6-23-18)11-28(2,22)26/h3-10,22H,11H2,1-2H3,(H,23,24,25)/t28-/m0/s1

| StdInChI_comment =

| StdInChIKey = YZCUMZWULWOUMD-NDEPHWFRSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Enitociclib is an experimental drug that is being investigated for the treatment of cancer.{{cite web | url = https://adisinsight.springer.com/drugs/800044155 | title = Enitociclib - Vincerx Pharma | work = AdisInsight | publisher = Springer Nature Switzerland AG }} It is an inhibitor of the kinase CDK9.{{cite journal | vauthors = Morillo D, Vega G, Moreno V | title = CDK9 INHIBITORS: a promising combination partner in the treatment of hematological malignancies | journal = Oncotarget | volume = 14 | issue = | pages = 749–752 | date = August 2023 | pmid = 37552223 | pmc = 10408673 | doi = 10.18632/oncotarget.28473 }}{{cite journal | vauthors = Frigault MM, Mithal A, Wong H, Stelte-Ludwig B, Mandava V, Huang X, Birkett J, Johnson AJ, Izumi R, Hamdy A | title = Enitociclib, a Selective CDK9 Inhibitor, Induces Complete Regression of MYC+ Lymphoma by Downregulation of RNA Polymerase II Mediated Transcription | journal = Cancer Research Communications | volume = 3 | issue = 11 | pages = 2268–2279 | date = November 2023 | pmid = 37882668 | pmc = 10634346 | doi = 10.1158/2767-9764.CRC-23-0219 }}

References