Epacadostat

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| IUPAC_name = (Z)-N-(3-Bromo-4-fluorophenyl)-N'-hydroxy-4-{[2-(sulfamoylamino)ethyl]amino}-1,2,5-oxadiazole-3-carboximidamide

| image = Epacadostat.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1204669-58-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 71596A9R13

| class =

| ATCvet =

| ATC_prefix = L01

| ATC_suffix = XX58

| PubChem =

| ChemSpiderID = 34448418

| DrugBank = DB11717

| KEGG = D11049

| C=11|H=13|Br=1|F=1|N=7|O=4|S=1

| smiles = c1cc(c(cc1N/C(=N\O)/c2c(non2)NCCNS(=O)(=O)N)Br)F

| StdInChI=1S/C11H13BrFN7O4S/c12-7-5-6(1-2-8(7)13)17-11(18-21)9-10(20-24-19-9)15-3-4-16-25(14,22)23/h1-2,5,16,21H,3-4H2,(H,15,20)(H,17,18)(H2,14,22,23)

| StdInChIKey=FBKMWOJEPMPVTQ-UHFFFAOYSA-N

}}

Epacadostat (previously INCB24360) is an investigational drug for cancer.{{cite web | url = https://www.cancer.gov/publications/dictionaries/cancer-drug?cdrid=685310 | work = NCI Drug Dictionary | title = Epacadostat | publisher = National Cancer Institute| date = 2011-02-02 }} Epacadostat is an inhibitor of indoleamine 2,3-dioxygenase-1 (IDO1).{{cite journal | vauthors = Brochez L, Chevolet I, Kruse V | title = The rationale of indoleamine 2,3-dioxygenase inhibition for cancer therapy | journal = European Journal of Cancer | volume = 76 | pages = 167–182 | date = May 2017 | pmid = 28324751 | doi = 10.1016/j.ejca.2017.01.011 | doi-access = free }}{{cite journal | vauthors = Yue EW, Sparks R, Polam P, Modi D, Douty B, Wayland B, Glass B, Takvorian A, Glenn J, Zhu W, Bower M, Liu X, Leffet L, Wang Q, Bowman KJ, Hansbury MJ, Wei M, Li Y, Wynn R, Burn TC, Koblish HK, Fridman JS, Emm T, Scherle PA, Metcalf B, Combs AP | display-authors = 6 | title = INCB24360 (Epacadostat), a Highly Potent and Selective Indoleamine-2,3-dioxygenase 1 (IDO1) Inhibitor for Immuno-oncology | journal = ACS Medicinal Chemistry Letters | volume = 8 | issue = 5 | pages = 486–491 | date = May 2017 | pmid = 28523098 | pmc = 5430407 | doi = 10.1021/acsmedchemlett.6b00391 }} Epacadostat inhibits IDO1 by competitively blocking it, without interfering with IDO2 or tryptophan 2,3-dioxygenase (TDO). It has antitumor activity in some models, though is most effective when combined with other immunotherapy agents.{{cite journal | vauthors = Van den Eynde BJ, van Baren N, Baurain JF |title=Is There a Clinical Future for IDO1 Inhibitors After the Failure of Epacadostat in Melanoma?|year=2020 |journal=Annual Review of Cancer Biology |volume=4 |pages=241–256 |doi=10.1146/annurev-cancerbio-030419-033635|doi-access=free}}