Epicillin
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443841117
| IUPAC_name = (2S,5R,6R)-6-
| image = Dexacillin.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 26774-90-3
| ATC_prefix = J01
| ATC_suffix = CA07
| ATC_supplemental =
| PubChem = 71392
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3LU1L73C8Y
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 64486
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](C/1=C/C\C=C/C\1)N)[C@H]3SC2(C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = RPBAFSBGYDKNRG-NJBDSQKTSA-N
| chemical_formula =
| C=16 | H=21 | N=3 | O=4 | S=1
}}
Epicillin (INN) is a penicillin antibiotic. It is not approved by the FDA for use in the United States.{{cn|date=March 2023}}
It is an aminopenicillin.{{cite journal | vauthors = Bergan T | title = Studies on aminopenicillin developments. Proceedings of a symposium. Concluding remarks | journal = Infection | volume = 7 | pages = S507-512 | date = 1979 | issue = Suppl 5 | pmid = 389828 | doi = 10.1007/bf01659785 | s2cid = 46974138 }}{{cite journal | vauthors = Mombelli G | title = [Aminopenicillin: when, how, what kind?] | language = de | journal = Schweizerische Medizinische Wochenschrift | volume = 111 | issue = 18 | pages = 641–5 | date = May 1981 | pmid = 7244588 }}
References
{{reflist}}
{{PenicillinAntiBiotics|state=collapsed}}
{{antibiotic-stub}}