Epicillin

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443841117

| IUPAC_name = (2S,5R,6R)-6-[[(2R)-2-Amino-2-(1-cyclohexa-1,4-dienyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

| image = Dexacillin.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 26774-90-3

| ATC_prefix = J01

| ATC_suffix = CA07

| ATC_supplemental =

| PubChem = 71392

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3LU1L73C8Y

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64486

| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](C/1=C/C\C=C/C\1)N)[C@H]3SC2(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RPBAFSBGYDKNRG-NJBDSQKTSA-N

| chemical_formula =

| C=16 | H=21 | N=3 | O=4 | S=1

}}

Epicillin (INN) is a penicillin antibiotic. It is not approved by the FDA for use in the United States.{{cn|date=March 2023}}

It is an aminopenicillin.{{cite journal | vauthors = Bergan T | title = Studies on aminopenicillin developments. Proceedings of a symposium. Concluding remarks | journal = Infection | volume = 7 | pages = S507-512 | date = 1979 | issue = Suppl 5 | pmid = 389828 | doi = 10.1007/bf01659785 | s2cid = 46974138 }}{{cite journal | vauthors = Mombelli G | title = [Aminopenicillin: when, how, what kind?] | language = de | journal = Schweizerische Medizinische Wochenschrift | volume = 111 | issue = 18 | pages = 641–5 | date = May 1981 | pmid = 7244588 }}