Epicriptine

{{Short description|Chemical compound}}

{{main|Dihydroergocryptine}}

{{Drugbox

| IUPAC_name = (2R,4R,7R)-N- [(1S,2S,4R,7S)- 2-hydroxy- 7-(S)-(1-methylpropyl)- 5,8-dioxo- 4-(propan-2-yl)- 3-oxa- 6,9-diazatricyclo [7.3.0.0^2,6]dodecan-4-yl]- 6-methyl- 6,11-diazatetracyclo [7.6.1.0^2,7.0^12,16] hexadeca- 1(16),9,12,14-tetraene- 4-carboxamide

| image = Epicriptine skeletal.svg

| pregnancy_category = Contraindicated

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 88660-47-3

| ATC_prefix = N04

| ATC_suffix = BC03

| ATC_supplemental = (alpha/beta)

| UNII = 5M64643B5U

| PubChem = 3084313

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 2341400

| ChEMBL = 1378681

| ChEBI = 59925

| C=32 | H=43 | N=5 | O=5

| smiles = CCC(C)[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C(C)C)NC(=O)[C@@H]4C[C@H]5[C@@H](CC6=CNC7=CC=CC5=C67)N(C4)C)O

| StdInChI = 1S/C32H43N5O5/c1-6-18(4)27-29(39)36-12-8-11-25(36)32(41)37(27)30(40)31(42-32,17(2)3)34-28(38)20-13-22-21-9-7-10-23-26(21)19(15-33-23)14-24(22)35(5)16-20/h7,9-10,15,17-18,20,22,24-25,27,33,41H,6,8,11-14,16H2,1-5H3,(H,34,38)/t18?,20-,22-,24-,25+,27+,31-,32+/m1/s1

| StdInChIKey = SBFXHXZNBNFPHV-CROXOCCCSA-N

| synonyms = beta-Dihydroergocryptine

}}

Epicriptine or beta-dihydroergocryptine is a dopamine agonist of the ergoline class. It constitutes one third of the mixture known as dihydroergocryptine, the other two thirds consisting of alpha-dihydroergocryptine. The alpha differs from the beta form only in the position of a single methyl group, which is a consequence of the biosynthesis in which the proteinogenic amino acid isoleucine is replaced by leucine.{{cite book|title=Medizinische Chemie|page=142| vauthors = Steinhilber D, Schubert-Zsilavecz M, Roth HJ |publisher=Deutscher Apotheker Verlag|location=Stuttgart|year=2005|isbn=3-7692-3483-9|language=German}}