Epolactaene

{{Chembox

| ImageFile = Epolactaene Structure.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = Methyl (2E,3E,5E,9E)-2-ethylidene-11-[(1R,5R)-4-hydroxy-4-methyl-2-oxo-6-oxa-3-azabicyclo[3.1.0]hexan-1-yl]-4,10-dimethyl-11-oxoundeca-3,5,9-trienoate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 167782-17-4

| ChEMBL = 183869

| PubChem = 6442272

| SMILES = C/C=C(\C=C(/C)\C=C\CC/C=C(\C)/C(=O)[C@@]12[C@@H](O1)C(NC2=O)(C)O)/C(=O)OC

| ChemSpiderID = 4946360

| StdInChI = 1S/C21H27NO6/c1-6-15(17(24)27-5)12-13(2)10-8-7-9-11-14(3)16(23)21-18(28-21)20(4,26)22-19(21)25/h6,8,10-12,18,26H,7,9H2,1-5H3,(H,22,25)/b10-8+,13-12+,14-11+,15-6+/t18-,20?,21-/m0/s1

| StdInChIKey = GFRNQYUCUNYIEN-ZLXMTJSISA-N}}

|Section2={{Chembox Properties

| C=21 | H=27 | N=1 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Epolactaene is a neuritogenic fungal isolate.{{cite journal | pmid =7649877 | title = Epolactaene, a novel neuritogenic compound in human neuroblastoma cells, produced by a marine fungus | year =1995 | last1 =Kakeya | first1 =H | last2 =Takahashi | first2 =I | last3 =Okada | first3 =G | last4 =Isono | first4 =K | last5 =Osada | first5 =H | volume =48 | issue =7 | pages =733–5 | journal =The Journal of Antibiotics | doi=10.7164/antibiotics.48.733| doi-access =free }}{{cite journal|vauthors=Nagumo Y, Kakeya H, Shoji M, Hayashi Y, Dohmae N, Osada H | title=Epolactaene binds human Hsp60 Cys442 resulting in the inhibition of chaperone activity. | journal=Biochem J | year= 2005 | volume= 387 | issue= Pt 3 | pages= 835–40 | pmid=15603555 | doi=10.1042/BJ20041355 | pmc=1135015 }}{{cite journal|vauthors=Mizushina Y, Kuramochi K, Ikawa H, Kuriyama I, Shimazaki N, Takemura M | title=Structural analysis of epolactaene derivatives as DNA polymerase inhibitors and anti-inflammatory compounds. | journal=Int J Mol Med | year= 2005 | volume= 15 | issue= 5 | pages= 785–93 | doi= 10.3892/ijmm.15.5.785| pmid=15806299 |display-authors=etal}}