Eprazinone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447815143

| IUPAC_name = 3-[4-(2-ethoxy-2-phenyl-ethyl)piperazin-1-yl]-2-methyl-1-phenyl-propan-1-one

| image = eprazinone.png

| tradename = Eftapan, Isilung, Mucitux

| Drugs.com = {{drugs.com|international|eprazinone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 10402-90-1

| ATC_prefix = R05

| ATC_suffix = CB04

| PubChem = 3245

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08990

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 883YNL63WU

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07902

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3132

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 82716

| C=24 | H=32 | N=2 | O=2

| smiles = CCOC(CN1CCN(CC1)CC(C)C(=O)C2=CC=CC=C2)C3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H32N2O2/c1-3-28-23(21-10-6-4-7-11-21)19-26-16-14-25(15-17-26)18-20(2)24(27)22-12-8-5-9-13-22/h4-13,20,23H,3,14-19H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BSHWLCACYCVCJE-UHFFFAOYSA-N

}}

Eprazinone (trade names Eftapan, Isilung, Mucitux) is a mucolytic and bronchospasm relieving drug.{{cite journal | vauthors = Spitzer W | title = [The efficacy of eprazinone dihydrochloride (Eftapan) in double-blind studies] | journal = Fortschritte der Medizin | volume = 98 | issue = 22 | pages = (871-4) | date = June 1980 | pmid = 6997154 }} It has been marketed in many European countries, but not in the US or United Kingdom.{{cite book |isbn=0-8103-7177-4 |title=Drugs Available Abroad, 1st Edition |page=76 |date=1991 | vauthors = Schlesser JL |publisher=Derwent Publications Ltd.}}