Esfenvalerate

{{Chembox

| Name =Esfenvalerate

| ImageFile =Esfenvalerate.svg

| ImageAlt =

| ImageCaption =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| ImageCaption1 =

| PIN = (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate

| OtherNames =Asana

(S)-Fenvalerate

(S)-cyano-(3-phenoxy phenyl)-methyl-(S)-4-chloro-α-(1-methyl ethyl) benzene acetate

Chloro-α-(1-methylethyl)benzeneacetic acid

cyano(3-phenoxyphenyl)methyl ester (CAS)

(S-(R,R))-4-chloro-α-(1-methylethyl) benzeneacetic acid

cyano-(3-phenoxyphenyl)methylester

(S)-α-cyano-3-phenoxy benzyl (S)-2-(4-chloro-phenyl) isovalerate

Fenvalerate A-Alpha

(S-(R*,R*))-Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-cyano(3-phenoxyphenyl)methylester

Cyano-3-phenoxybenzyl (S)-2-(4-chlorophenyl)isovalerate

Cyano-3-phenoxybenzyl (S)-2-(4-chlorophenyl)-3-methylbutyrate{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:Dj4zTYgWkVwJ:www.cdpr.ca.gov/docs/emon/pubs/fatememo/esfen.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESioBjkb-ZFR_RL4b81PgVXQtE1uuVNiP1oizd-B5RHIElqfOsbh11O7x5n5U7QO5X_Ds0xSwaqa_hO3sr8ipOGsoy7zWrd3ZHnpjvZvb9hV4Ot9XQeZEzZZKUmLOeC13D3sii_j&sig=AHIEtbT0y5uiRpRhAiBnZ4nP9zihtQ56GA | title=Environmental Fate of Esfenvalerate | publisher=California Environmental Protection Agency | access-date=January 10, 2013 | author=Kelly, Kevin}}

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 66230-04-4

| CASNo_Comment =

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 10342051

| ChemSpiderID =8517510

| EC_number = 613-911-9

| UNNumber = 3349

| UNII = 7F07OXM0PP

| DrugBank =

| KEGG = C18147

| MeSHName =

| ChEBI = 39346

| ChEMBL = 1891190

| RTECS =

| StdInChI= 1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m0/s1

| StdInChIKey = NYPJDWWKZLNGGM-BJKOFHAPSA-N

| SMILES = CC(C)[C@@H](C(=O)O[C@@H](C#N)c1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1

| Beilstein = 4275674

| Gmelin =

| 3DMet =}}

|Section2={{Chembox Properties

| C=25 | H=22 | Cl=1 | N=1 | O=3

| Appearance =

| Density =1.211 g/cm3

| MeltingPtC = 60

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| LogP = 6.22

| VaporPressure =0 mmHg at 25 °C

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

| Solvent =}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

|Section4={{Chembox Thermochemistry

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity = }}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|313|316|317|320|330|335|370|373|410}}

| PPhrases = {{P-phrases|260|261|264|270|271|272|273|280|284|301+310|302+352|304+340|305+351+338|307+311|310|312|314|320|321|330|332+313|333+313|337+313|363|391|403+233|405|501}}

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPtC = 256

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Esfenvalerate is a synthetic pyrethroid insecticide marketed under the brand Asana.{{cite web | url=http://edis.ifas.ufl.edu/pi091 | title=Pesticide Toxicity Profile: Synthetic Pyrethroid Pesticides | publisher=University of Florida | year=2012 | access-date=January 10, 2013 | author=Fishel, Frederick M. | archive-date=May 12, 2016 | archive-url=https://web.archive.org/web/20160512091153/http://edis.ifas.ufl.edu/pi091 | url-status=dead }} It is the (S)-enantiomer of fenvalerate.{{cite web | url=http://pmep.cce.cornell.edu/profiles/extoxnet/dienochlor-glyphosate/esfenvalerate-ext.html | title=Esfenvalerate | publisher=Cooperative Extension Offices of Cornell University, Michigan State University, Oregon State University, and University of California at Davis | work=EXTONET (Extension Toxicology Network) | date=May 1994 | access-date=January 10, 2013}}

In the United States, a limit of .05 ppm of the chemical's residue is permissible in food.{{cite book | title=The Code of Federal Regulations of the United States of America | publisher=U.S. Government Printing Office | year=2006 | pages=445–446 | url=https://books.google.com/books?id=ifk6AAAAIAAJ&q=%22%28S%29-cyano+%283-phenoxyphenyl%29+methyl-%28S%29-4-chloro-alpha-%281-methylethyl%29+benzeneacetate%22&pg=PA446}}

References

{{reflist}}

{{insecticides}}

Category:Insecticides

Category:Nitriles

Category:4-Chlorophenyl compounds

{{organic-compound-stub}}