Estradiol 17β-benzoate

{{Short description|Chemical compound}}

{{Distinguish|Estradiol benzoate}}

{{Infobox drug

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate

| image = Estradiol 17β-benzoate.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 983-30-2

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 66420

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 59794

| UNII = 3GFX41Z289

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = E2-17B; ZYC30

| C=25 | H=28 | O=3

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)C4=CC=CC=C4)CCC5=C3C=CC(=C5)O

| StdInChI_Ref =

| StdInChI = 1S/C25H28O3/c1-25-14-13-20-19-10-8-18(26)15-17(19)7-9-21(20)22(25)11-12-23(25)28-24(27)16-5-3-2-4-6-16/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = AAGOOGMSOHOVSE-BZDYCCQFSA-N

}}

Estradiol 17β-benzoate (E2-17B) is an estrogen and an estrogen ester—specifically, the C17β benzoate ester of estradiol—which was never marketed.{{cite journal | vauthors = Junkmann K, Witzel H | title = [Chemistry and pharmacology of steroid hormone esters] | language = de | journal = Zeitschrift für Vitamin-, Hormon- und Fermentforschung | volume = 9 | issue = 1–2 | pages = 97–143 contd | date = 1957 | pmid = 13531579 | trans-title = Chemistry and pharmacology of steroid hormone esters }}{{cite journal| vauthors = Perez E, Cai ZY, Covey DF, Simpkins JW |title=Neuroprotective effects of estratriene analogs: structure-activity relationships and molecular optimization|journal=Drug Development Research|volume=66|issue=2|year=2005|pages=78–92|issn=0272-4391|doi=10.1002/ddr.20047|s2cid=86133327}}{{cite journal | vauthors = Yi KD, Perez E, Yang S, Liu R, Covey DF, Simpkins JW | title = The assessment of non-feminizing estrogens for use in neuroprotection | journal = Brain Research | volume = 1379 | pages = 61–70 | date = March 2011 | pmid = 21111714 | pmc = 3048764 | doi = 10.1016/j.brainres.2010.11.058 }} It is the C17β positional isomer of the better-known and clinically used estradiol ester estradiol benzoate (estradiol 3-benzoate; Progynon-B). Estradiol 17β-benzoate was first described in the 1930s.{{cite journal | vauthors = Parkes AS | title = Relative duration of action of various esters of oestrone, oestradiol and oestriol | journal = The Biochemical Journal | volume = 31 | issue = 4 | pages = 579–585 | date = April 1937 | pmid = 16746375 | pmc = 1266977 | doi = 10.1042/bj0310579 }}